Rabdoternin B
Internal ID | fe23dc36-686a-4315-acf8-d64ba3f2815b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Diterpene lactones |
IUPAC Name | (1R,2R,5S,7R,8R,9S,10S,11R,15S,18R)-7,9,10,15,18-pentahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-16-one |
SMILES (Canonical) | CC1(CCC(C23C1C(C(C45C2CCC(C4O)C(=C)C5O)(OC3=O)O)O)O)C |
SMILES (Isomeric) | CC1(CC[C@@H]([C@]23[C@@H]1[C@@H]([C@]([C@]45[C@H]2CC[C@H]([C@H]4O)C(=C)[C@H]5O)(OC3=O)O)O)O)C |
InChI | InChI=1S/C20H28O7/c1-8-9-4-5-10-18-11(21)6-7-17(2,3)12(18)15(24)20(26,27-16(18)25)19(10,13(8)22)14(9)23/h9-15,21-24,26H,1,4-7H2,2-3H3/t9-,10-,11-,12+,13+,14+,15-,18-,19-,20+/m0/s1 |
InChI Key | FAAQEWNSVUDRKJ-QNZWLQKMSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H28O7 |
Molecular Weight | 380.40 g/mol |
Exact Mass | 380.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | -0.70 |
128887-81-0 |
(1S,4aR,5S,6S,6aR,7R,9S,11aR,11bR,14R)-1,5,6,7,14-pentahydroxy-4,4-dimethyl-8-methylenedodecahydro-1H-6,11b-(epoxymethano)-6a,9-methanocyclohepta[a]naphthalen-12-one |
(-)-Rabdoternin B |
CHEMBL2407388 |
DTXSID60926232 |
1,6,7,14,15-Pentahydroxy-7,20-epoxykaur-16-en-20-one |
(1R,2R,5S,7R,8R,9S,10S,11R,15S,18R)-7,9,10,15,18-pentahydroxy-12,12-dimethyl-6-methylidene-17-oxapentacyclo[7.6.2.15,8.01,11.02,8]octadecan-16-one |
Kaur-16-en-20-oic acid, 1,6,7,7,14,15-hexahydroxy-, 20,7-lactone, (1alpha,6beta,7alpha,14R,15beta)- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.41% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 88.49% | 98.95% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.48% | 96.61% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.77% | 94.75% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.51% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.92% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.33% | 96.77% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.81% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.78% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.23% | 100.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.04% | 97.25% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.56% | 95.56% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.83% | 97.28% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.11% | 93.04% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.82% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon rosthornii |
Isodon rubescens |
Isodon ternifolius |
PubChem | 3086623 |
LOTUS | LTS0183688 |
wikiData | Q82900723 |