R-(-)-actinodaphnine
Internal ID | 3d33b03a-a3f0-4bff-ba72-f164dd7e6e8e |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | (12R)-17-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaen-16-ol |
SMILES (Canonical) | COC1=C(C=C2CC3C4=C(C2=C1)C5=C(C=C4CCN3)OCO5)O |
SMILES (Isomeric) | COC1=C(C=C2C[C@@H]3C4=C(C2=C1)C5=C(C=C4CCN3)OCO5)O |
InChI | InChI=1S/C18H17NO4/c1-21-14-7-11-10(5-13(14)20)4-12-16-9(2-3-19-12)6-15-18(17(11)16)23-8-22-15/h5-7,12,19-20H,2-4,8H2,1H3/t12-/m1/s1 |
InChI Key | VYJUHRAQPIBWNV-GFCCVEGCSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C18H17NO4 |
Molecular Weight | 311.30 g/mol |
Exact Mass | 311.11575802 g/mol |
Topological Polar Surface Area (TPSA) | 60.00 Ų |
XlogP | 2.40 |
Atomic LogP (AlogP) | 2.54 |
H-Bond Acceptor | 5 |
H-Bond Donor | 2 |
Rotatable Bonds | 1 |
MLS000574934 |
CHEBI:70638 |
SMR000156298 |
CHEMBL1588263 |
BDBM50136 |
cid_11957301 |
DTXSID101121123 |
HMS2218M06 |
NCGC00247613-01 |
Q27138971 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9540 | 95.40% |
Caco-2 | + | 0.7636 | 76.36% |
Blood Brain Barrier | + | 0.7750 | 77.50% |
Human oral bioavailability | + | 0.5286 | 52.86% |
Subcellular localzation | Mitochondria | 0.5361 | 53.61% |
OATP2B1 inhibitior | - | 0.8556 | 85.56% |
OATP1B1 inhibitior | + | 0.9054 | 90.54% |
OATP1B3 inhibitior | + | 0.9531 | 95.31% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.6500 | 65.00% |
BSEP inhibitior | + | 0.6980 | 69.80% |
P-glycoprotein inhibitior | - | 0.8347 | 83.47% |
P-glycoprotein substrate | - | 0.6991 | 69.91% |
CYP3A4 substrate | + | 0.5839 | 58.39% |
CYP2C9 substrate | - | 0.8216 | 82.16% |
CYP2D6 substrate | + | 0.6215 | 62.15% |
CYP3A4 inhibition | + | 0.5242 | 52.42% |
CYP2C9 inhibition | - | 0.8569 | 85.69% |
CYP2C19 inhibition | - | 0.5508 | 55.08% |
CYP2D6 inhibition | + | 0.6539 | 65.39% |
CYP1A2 inhibition | + | 0.6365 | 63.65% |
CYP2C8 inhibition | + | 0.5134 | 51.34% |
CYP inhibitory promiscuity | + | 0.5656 | 56.56% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.6052 | 60.52% |
Eye corrosion | - | 0.9894 | 98.94% |
Eye irritation | - | 0.8471 | 84.71% |
Skin irritation | - | 0.7289 | 72.89% |
Skin corrosion | - | 0.9375 | 93.75% |
Ames mutagenesis | + | 0.6200 | 62.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4499 | 44.99% |
Micronuclear | + | 0.5200 | 52.00% |
Hepatotoxicity | - | 0.7083 | 70.83% |
skin sensitisation | - | 0.8314 | 83.14% |
Respiratory toxicity | + | 0.5889 | 58.89% |
Reproductive toxicity | + | 0.9222 | 92.22% |
Mitochondrial toxicity | + | 0.8250 | 82.50% |
Nephrotoxicity | - | 0.6637 | 66.37% |
Acute Oral Toxicity (c) | III | 0.5742 | 57.42% |
Estrogen receptor binding | + | 0.7958 | 79.58% |
Androgen receptor binding | - | 0.5655 | 56.55% |
Thyroid receptor binding | + | 0.7170 | 71.70% |
Glucocorticoid receptor binding | + | 0.6725 | 67.25% |
Aromatase binding | - | 0.5000 | 50.00% |
PPAR gamma | + | 0.8228 | 82.28% |
Honey bee toxicity | - | 0.7824 | 78.24% |
Biodegradation | - | 0.9000 | 90.00% |
Crustacea aquatic toxicity | - | 0.5449 | 54.49% |
Fish aquatic toxicity | - | 0.5000 | 50.00% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL2392 | P06746 | DNA polymerase beta |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL5514 | P42858 | Huntingtin |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 |
5612.2 nM |
IC50 |
via CMAUP
|
CHEMBL1287622 | Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 |
35481.3 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
14125.4 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
22387.2 nM 14125.4 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
11220.2 nM |
Potency |
via CMAUP
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
56.2 nM 56.2 nM |
Potency Potency |
via Super-PRED
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.73% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.42% | 96.09% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.30% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.04% | 97.09% |
CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 93.54% | 95.55% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.27% | 93.99% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 91.72% | 82.67% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 91.50% | 88.48% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.49% | 92.94% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.45% | 92.62% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.26% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.10% | 86.33% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 90.96% | 91.79% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.63% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.45% | 90.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.25% | 96.21% |
CHEMBL2581 | P07339 | Cathepsin D | 88.45% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.41% | 94.45% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.98% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.81% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.35% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.54% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.47% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.86% | 96.95% |
CHEMBL2535 | P11166 | Glucose transporter | 83.86% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.24% | 95.56% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.21% | 96.86% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 81.92% | 80.96% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.71% | 95.78% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.34% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona glabra |
Laurus nobilis |
PubChem | 11957301 |
NPASS | NPC312918 |
ChEMBL | CHEMBL1588263 |
LOTUS | LTS0223874 |
wikiData | Q27138971 |