Quercetin 3-sophoroside
Internal ID | 1036a2cc-5035-417e-a944-947a34a167c3 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 3-[(2S,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
SMILES (Canonical) | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)OC5C(C(C(C(O5)CO)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4C(C([C@@H](C(O4)CO)O)O)O[C@H]5[C@@H](C([C@@H](C(O5)CO)O)O)O)O)O |
InChI | InChI=1S/C27H30O17/c28-6-14-17(34)20(37)22(39)26(41-14)44-25-21(38)18(35)15(7-29)42-27(25)43-24-19(36)16-12(33)4-9(30)5-13(16)40-23(24)8-1-2-10(31)11(32)3-8/h1-5,14-15,17-18,20-22,25-35,37-39H,6-7H2/t14?,15?,17-,18-,20?,21?,22-,25?,26+,27+/m1/s1 |
InChI Key | RDUAJIJVNHKTQC-IROKYFGSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O17 |
Molecular Weight | 626.50 g/mol |
Exact Mass | 626.14829948 g/mol |
Topological Polar Surface Area (TPSA) | 286.00 Ų |
XlogP | -1.20 |
CHEBI:192456 |
LMPK12112094 |
3-[(2S,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.63% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.86% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.58% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 94.52% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.05% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.62% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.07% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.69% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.54% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 88.97% | 90.71% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.60% | 95.64% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.48% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.84% | 95.56% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.66% | 86.92% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.94% | 95.78% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.60% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cistus ladanifer |
Iochroma gesnerioides |
Lathyrus nissolia |
Parietaria officinalis |
Ranunculus aquatilis |
Ranunculus peltatus |
PubChem | 44259144 |
LOTUS | LTS0192114 |
wikiData | Q104392837 |