Putranjivadione
Internal ID | e7bfc1b4-c0c9-45da-8762-19386780872d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 4,4a,6a,6b,8a,11,11,14a-octamethyl-1,2,4,5,6a,7,8,9,10,12,12a,13,14,14b-tetradecahydropicene-3,6-dione |
SMILES (Canonical) | CC1C(=O)CCC2C1(CC(=O)C3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C)C)C)C)C)C |
SMILES (Isomeric) | CC1C(=O)CCC2C1(CC(=O)C3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C)C)C)C)C)C |
InChI | InChI=1S/C30H48O2/c1-19-20(31)9-10-22-27(5)14-16-29(7)23-18-25(2,3)11-12-26(23,4)13-15-30(29,8)24(27)21(32)17-28(19,22)6/h19,22-24H,9-18H2,1-8H3 |
InChI Key | GPIWSGIAALYKPX-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H48O2 |
Molecular Weight | 440.70 g/mol |
Exact Mass | 440.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 34.10 Ų |
XlogP | 8.20 |
D:A-Friedooleanane-3,7-dione |
GPIWSGIAALYKPX-UHFFFAOYSA-N |
4,4a,6b,8a,11,11,12b,14a-Octamethyloctadecahydro-3,6(2H,4H)-picenedione # |
![2D Structure of Putranjivadione 2D Structure of Putranjivadione](https://plantaedb.com/storage/docs/compounds/2023/11/putranjivadione.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.28% | 97.25% |
CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 91.25% | 94.78% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.94% | 97.09% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 90.55% | 96.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.49% | 94.45% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.94% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 87.66% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.41% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.35% | 82.69% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.35% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.48% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.72% | 94.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.09% | 99.23% |
CHEMBL1871 | P10275 | Androgen Receptor | 82.07% | 96.43% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.68% | 97.05% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.24% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia crassicolumna |
Drypetes gossweileri |
Drypetes inaequalis |
Drypetes laciniata |
Drypetes molunduana |
Drypetes tessmanniana |
Euonymus laxiflorus |
Putranjiva roxburghii |
PubChem | 634915 |
LOTUS | LTS0221734 |
wikiData | Q105023682 |