Picrasin A
Internal ID | bec7bfb3-3fc9-4580-b7a8-dc625fb30bd0 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Quassinoids |
IUPAC Name | (1S,2S,6S,7S,9R,13R,14R,16R,17S)-16-hydroxy-4-methoxy-2,6,14,17-tetramethyl-14-[(3R)-5-oxooxolane-3-carbonyl]-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-4-ene-3,11-dione |
SMILES (Canonical) | CC1C=C(C(=O)C2(C1CC3C4(C2C(CC(C4CC(=O)O3)(C)C(=O)C5CC(=O)OC5)O)C)C)OC |
SMILES (Isomeric) | C[C@@H]1C=C(C(=O)[C@]2([C@H]1C[C@@H]3[C@@]4([C@@H]2[C@@H](C[C@@]([C@@H]4CC(=O)O3)(C)C(=O)[C@@H]5CC(=O)OC5)O)C)C)OC |
InChI | InChI=1S/C26H34O8/c1-12-6-16(32-5)23(31)25(3)14(12)8-18-26(4)17(9-20(29)34-18)24(2,10-15(27)21(25)26)22(30)13-7-19(28)33-11-13/h6,12-15,17-18,21,27H,7-11H2,1-5H3/t12-,13-,14+,15-,17+,18-,21-,24-,25+,26-/m1/s1 |
InChI Key | BIJFTRIMTHYJOV-QRWZCSJESA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H34O8 |
Molecular Weight | 474.50 g/mol |
Exact Mass | 474.22536804 g/mol |
Topological Polar Surface Area (TPSA) | 116.00 Ų |
XlogP | 1.80 |
27368-79-2 |
Nigakilactone G |
Nigakilacton G |
(1S,2S,6S,7S,9R,13R,14R,16R,17S)-16-hydroxy-4-methoxy-2,6,14,17-tetramethyl-14-[(3R)-5-oxooxolane-3-carbonyl]-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-4-ene-3,11-dione |
CHEBI:80889 |
DTXSID40950070 |
C17049 |
Q27151385 |
11-Hydroxy-2-methoxy-13-(5-oxooxolane-3-carbonyl)picras-2-ene-1,16-dione |
![2D Structure of Picrasin A 2D Structure of Picrasin A](https://plantaedb.com/storage/docs/compounds/2023/11/picrasin-a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.70% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.18% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.46% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.07% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.99% | 95.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.51% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.35% | 91.19% |
CHEMBL2581 | P07339 | Cathepsin D | 86.70% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.83% | 89.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.56% | 97.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.35% | 95.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.86% | 93.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 82.72% | 96.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.58% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.97% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.91% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Picrasma javanica |
Picrasma quassioides |
PubChem | 185611 |
LOTUS | LTS0142425 |
wikiData | Q27151385 |