Phenanthro(3,4-d)-1,3-dioxole-5-ethanamine, N,N-dimethyl-
Internal ID | 4828b301-7981-47cc-8a61-6ef7a31bb3af |
Taxonomy | Alkaloids and derivatives > 6,6a-secoaporphines |
IUPAC Name | N,N-dimethyl-2-naphtho[2,1-g][1,3]benzodioxol-5-ylethanamine |
SMILES (Canonical) | CN(C)CCC1=CC2=C(C3=C1C=CC4=CC=CC=C43)OCO2 |
SMILES (Isomeric) | CN(C)CCC1=CC2=C(C3=C1C=CC4=CC=CC=C43)OCO2 |
InChI | InChI=1S/C19H19NO2/c1-20(2)10-9-14-11-17-19(22-12-21-17)18-15-6-4-3-5-13(15)7-8-16(14)18/h3-8,11H,9-10,12H2,1-2H3 |
InChI Key | FXTBDJZGDJJCQU-UHFFFAOYSA-N |
Popularity | 9 references in papers |
Molecular Formula | C19H19NO2 |
Molecular Weight | 293.40 g/mol |
Exact Mass | 293.141578849 g/mol |
Topological Polar Surface Area (TPSA) | 21.70 Ų |
XlogP | 4.50 |
22108-99-2 |
Stephanthrine |
MLS001207641 |
N,N-dimethyl-2-(2H-phenanthro[3,4-d][1,3]dioxol-5-yl)ethan-1-amine |
Dimethyl-(2-phenanthro[3,4-d][1,3]dioxol-5-yl-ethyl)-amine |
SMR000517938 |
Phenanthro(3,4-d)-1,3-dioxole-5-ethanamine, N,N-dimethyl- |
ChemDiv3_003111 |
Oprea1_105893 |
Oprea1_353681 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
28183.8 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
17782.8 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL240 | Q12809 | HERG | 99.90% | 89.76% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.30% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 92.41% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.82% | 94.73% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.56% | 93.99% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.63% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.61% | 95.56% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 90.40% | 87.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.81% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.64% | 96.09% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.69% | 96.67% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.64% | 86.33% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.97% | 96.77% |
CHEMBL3959 | P16083 | Quinone reductase 2 | 84.85% | 89.49% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 83.44% | 95.83% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.72% | 94.00% |
CHEMBL228 | P31645 | Serotonin transporter | 80.12% | 95.51% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 161379 |
NPASS | NPC145304 |
ChEMBL | CHEMBL492418 |
LOTUS | LTS0226624 |
wikiData | Q82921989 |