Phaseolin; Phaseolin (phytoalexin)
Internal ID | fc8ae66b-654c-4aea-9fe3-6db1ce624d5b |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Furanoisoflavonoids > Pterocarpans |
IUPAC Name | 17,17-dimethyl-4,12,18-trioxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),5(10),6,8,14(19),15,20-heptaen-7-ol |
SMILES (Canonical) | CC1(C=CC2=C(O1)C=CC3=C2OC4C3COC5=C4C=CC(=C5)O)C |
SMILES (Isomeric) | CC1(C=CC2=C(O1)C=CC3=C2OC4C3COC5=C4C=CC(=C5)O)C |
InChI | InChI=1S/C20H18O4/c1-20(2)8-7-14-16(24-20)6-5-12-15-10-22-17-9-11(21)3-4-13(17)19(15)23-18(12)14/h3-9,15,19,21H,10H2,1-2H3 |
InChI Key | LWTDZKXXJRRKDG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H18O4 |
Molecular Weight | 322.40 g/mol |
Exact Mass | 322.12050905 g/mol |
Topological Polar Surface Area (TPSA) | 47.90 Ų |
XlogP | 3.60 |
17,17-Dimethyl-4,12,18-trioxapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),5(10),6,8,14(19),15,20-heptaen-7-ol |
Phaseolin; Phaseolin (phytoalexin) |
SCHEMBL33735 |
DTXSID20871956 |
6b,12b-Dihydro-3,3-dimethyl-3H,7H-furo[3,2-c:5,4-f]bis[1]benzopyran-10-ol, 9CI |
(2R,11R)-17,17-dimethyl-4,12,18-trioxapentacyclo[11.8.0.0^{2,11.0^{5,10.0^{14,19]henicosa-1(13),5(10),6,8,14(19),15,20-heptaen-7-ol |
3,3-Dimethyl-6b,12b-dihydro-3H,7H-pyrano[2',3':6,7][1]benzofuro[3,2-c][1]benzopyran-10-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.68% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.63% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.93% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.10% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.09% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.43% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.36% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.15% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.89% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.93% | 90.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.49% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.88% | 93.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.36% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.20% | 94.73% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.16% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.70% | 97.14% |
CHEMBL2535 | P11166 | Glucose transporter | 81.67% | 98.75% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.39% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.68% | 95.89% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.17% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Erythrina abyssinica |
Erythrina addisoniae |
Erythrina lysistemon |
Erythrina sigmoidea |
Erythrina variegata |
Lespedeza cyrtobotrya |
Phaseolus coccineus |
Phaseolus vulgaris |
PubChem | 4063834 |
LOTUS | LTS0107159 |
wikiData | Q105158582 |