Oxopurpureine
Internal ID | dafac6c4-fa93-4568-b9ed-66a40623ad01 |
Taxonomy | Alkaloids and derivatives > Aporphines |
IUPAC Name | 4,5,14,15,16-pentamethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-8-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C3=C(C(=C(C4=C3C(=NC=C4)C2=O)OC)OC)OC)OC |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)C3=C(C(=C(C4=C3C(=NC=C4)C2=O)OC)OC)OC)OC |
InChI | InChI=1S/C21H19NO6/c1-24-13-8-11-12(9-14(13)25-2)18(23)17-15-10(6-7-22-17)19(26-3)21(28-5)20(27-4)16(11)15/h6-9H,1-5H3 |
InChI Key | AZTLZBDEFBJZQG-UHFFFAOYSA-N |
Popularity | 7 references in papers |
Molecular Formula | C21H19NO6 |
Molecular Weight | 381.40 g/mol |
Exact Mass | 381.12123733 g/mol |
Topological Polar Surface Area (TPSA) | 76.10 Ų |
XlogP | 3.40 |
Atomic LogP (AlogP) | 3.49 |
H-Bond Acceptor | 7 |
H-Bond Donor | 0 |
Rotatable Bonds | 5 |
32845-27-5 |
MLS000574936 |
NSC 141544 |
SMR000156318 |
4,5,14,15,16-pentamethoxy-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-8-one |
HMS2220I24 |
CHEMBL456295 |
cid_284998 |
BDBM52490 |
DTXSID00301165 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9921 | 99.21% |
Caco-2 | + | 0.8349 | 83.49% |
Blood Brain Barrier | - | 0.5000 | 50.00% |
Human oral bioavailability | + | 0.5714 | 57.14% |
Subcellular localzation | Mitochondria | 0.5338 | 53.38% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9523 | 95.23% |
OATP1B3 inhibitior | + | 0.9817 | 98.17% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.9750 | 97.50% |
BSEP inhibitior | + | 0.5985 | 59.85% |
P-glycoprotein inhibitior | - | 0.4392 | 43.92% |
P-glycoprotein substrate | - | 0.7811 | 78.11% |
CYP3A4 substrate | + | 0.5685 | 56.85% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.7304 | 73.04% |
CYP3A4 inhibition | + | 0.7138 | 71.38% |
CYP2C9 inhibition | - | 0.9701 | 97.01% |
CYP2C19 inhibition | - | 0.5222 | 52.22% |
CYP2D6 inhibition | - | 0.8747 | 87.47% |
CYP1A2 inhibition | + | 0.9331 | 93.31% |
CYP2C8 inhibition | + | 0.6089 | 60.89% |
CYP inhibitory promiscuity | + | 0.7213 | 72.13% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9700 | 97.00% |
Carcinogenicity (trinary) | Non-required | 0.6378 | 63.78% |
Eye corrosion | - | 0.9900 | 99.00% |
Eye irritation | + | 0.5717 | 57.17% |
Skin irritation | - | 0.8346 | 83.46% |
Skin corrosion | - | 0.9809 | 98.09% |
Ames mutagenesis | + | 0.7536 | 75.36% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5355 | 53.55% |
Micronuclear | + | 0.7059 | 70.59% |
Hepatotoxicity | + | 0.7375 | 73.75% |
skin sensitisation | - | 0.9503 | 95.03% |
Respiratory toxicity | - | 0.5889 | 58.89% |
Reproductive toxicity | + | 0.6444 | 64.44% |
Mitochondrial toxicity | + | 0.5125 | 51.25% |
Nephrotoxicity | - | 0.6911 | 69.11% |
Acute Oral Toxicity (c) | II | 0.5437 | 54.37% |
Estrogen receptor binding | + | 0.8795 | 87.95% |
Androgen receptor binding | - | 0.5119 | 51.19% |
Thyroid receptor binding | + | 0.8434 | 84.34% |
Glucocorticoid receptor binding | + | 0.8971 | 89.71% |
Aromatase binding | + | 0.7398 | 73.98% |
PPAR gamma | + | 0.7305 | 73.05% |
Honey bee toxicity | - | 0.8678 | 86.78% |
Biodegradation | - | 0.9000 | 90.00% |
Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
Fish aquatic toxicity | - | 0.5201 | 52.01% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL1293299 | Q03164 | Histone-lysine N-methyltransferase MLL |
11220.2 nM |
Potency |
via CMAUP
|
CHEMBL5514 | P42858 | Huntingtin |
11220.2 nM |
Potency |
via CMAUP
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
10000 nM |
Potency |
via CMAUP
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
11220.2 nM |
Potency |
via CMAUP
|
CHEMBL1741200 | Q2TB90 | Putative hexokinase HKDC1 |
12100 nM 10100 nM |
IC50 IC50 |
via CMAUP
via CMAUP |
CHEMBL3797 | Q13315 | Serine-protein kinase ATM |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL1293232 | Q16637 | Survival motor neuron protein |
35481.3 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.88% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.83% | 94.00% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 92.74% | 96.67% |
CHEMBL2535 | P11166 | Glucose transporter | 91.95% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.31% | 86.33% |
CHEMBL5014 | O43353 | Serine/threonine-protein kinase RIPK2 | 90.93% | 86.79% |
CHEMBL5747 | Q92793 | CREB-binding protein | 89.84% | 95.12% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 89.70% | 94.03% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.33% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.48% | 96.00% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 88.44% | 96.47% |
CHEMBL2581 | P07339 | Cathepsin D | 88.07% | 98.95% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 85.02% | 96.00% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.99% | 92.38% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.39% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.23% | 85.14% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.79% | 100.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.16% | 92.98% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.14% | 91.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.40% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Annona mucosa |
Annona purpurea |
Annona squamosa |
Thalictrum microgynum |
PubChem | 284998 |
NPASS | NPC90875 |
ChEMBL | CHEMBL456295 |
LOTUS | LTS0179104 |
wikiData | Q82044802 |