Oovavljiumkkqs-uhfffaoysa-
| Internal ID | 21549cf1-b1a2-4187-9ffb-a3904fe6593d |
| Taxonomy | Benzenoids > Phenanthrenes and derivatives > Hydrophenanthrenes |
| IUPAC Name | 7-hydroxy-2-methoxy-8-(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-1,4-dione |
| SMILES (Canonical) | CC(=CCC1=C(C=CC2=C1CCC3=C2C(=O)C=C(C3=O)OC)O)C |
| SMILES (Isomeric) | CC(=CCC1=C(C=CC2=C1CCC3=C2C(=O)C=C(C3=O)OC)O)C |
| InChI | InChI=1S/C20H20O4/c1-11(2)4-5-13-12-6-7-15-19(14(12)8-9-16(13)21)17(22)10-18(24-3)20(15)23/h4,8-10,21H,5-7H2,1-3H3 |
| InChI Key | OOVAVLJIUMKKQS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 3.70 |
| OOVAVLJIUMKKQS-UHFFFAOYSA- |
| InChI=1/C20H20O4/c1-11(2)4-5-13-12-6-7-15-19(14(12)8-9-16(13)21)17(22)10-18(24-3)20(15)23/h4,8-10,21H,5-7H2,1-3H3 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.16% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.61% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.43% | 95.56% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.93% | 93.40% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.18% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.95% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.67% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.92% | 96.09% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.81% | 96.67% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.54% | 92.68% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.98% | 85.30% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.80% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.06% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.58% | 85.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.46% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Spiranthes sinensis |
| Spiranthes vernalis |
| PubChem | 14583240 |
| LOTUS | LTS0150916 |
| wikiData | Q105195633 |