Odoroside H
Internal ID | 9e409d76-7d49-4dbe-9d6c-2a9df1700009 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Cardenolides and derivatives > Cardenolide glycosides and derivatives |
IUPAC Name | 3-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-[(2R,3R,4S,5S,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CCC3(C(C2)CCC4C3CCC5(C4(CCC5C6=CC(=O)OC6)O)C)C)O)OC)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]4[C@@H]3CC[C@]5([C@@]4(CC[C@@H]5C6=CC(=O)OC6)O)C)C)O)OC)O |
InChI | InChI=1S/C30H46O8/c1-16-24(32)26(35-4)25(33)27(37-16)38-19-7-10-28(2)18(14-19)5-6-22-21(28)8-11-29(3)20(9-12-30(22,29)34)17-13-23(31)36-15-17/h13,16,18-22,24-27,32-34H,5-12,14-15H2,1-4H3/t16-,18-,19+,20-,21+,22-,24+,25-,26+,27+,28+,29-,30+/m1/s1 |
InChI Key | VPUNMTHWNSJUOG-HYDVPRFCSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H46O8 |
Molecular Weight | 534.70 g/mol |
Exact Mass | 534.31926842 g/mol |
Topological Polar Surface Area (TPSA) | 115.00 Ų |
XlogP | 2.10 |
Atomic LogP (AlogP) | 3.11 |
H-Bond Acceptor | 8 |
H-Bond Donor | 3 |
Rotatable Bonds | 4 |
18810-25-8 |
Odorosid H [German] |
Odorosid H |
BRN 0100751 |
3-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-[(2R,3R,4S,5S,6R)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
3beta-[(3-O-Methyl-6-deoxy-beta-D-galactopyranosyl)oxy]-14-hydroxy-5beta-card-20(22)-enolide |
4-18-00-01486 (Beilstein Handbook Reference) |
C30-H46-O8 |
CHEMBL504196 |
DTXSID601318195 |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of Odoroside H 2D Structure of Odoroside H](https://plantaedb.com/storage/docs/compounds/2023/07/odoroside-h.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9583 | 95.83% |
Caco-2 | - | 0.8001 | 80.01% |
Blood Brain Barrier | - | 0.7750 | 77.50% |
Human oral bioavailability | + | 0.5286 | 52.86% |
Subcellular localzation | Mitochondria | 0.7896 | 78.96% |
OATP2B1 inhibitior | - | 0.5896 | 58.96% |
OATP1B1 inhibitior | + | 0.9427 | 94.27% |
OATP1B3 inhibitior | + | 0.9683 | 96.83% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | - | 0.4534 | 45.34% |
P-glycoprotein inhibitior | - | 0.4422 | 44.22% |
P-glycoprotein substrate | + | 0.7776 | 77.76% |
CYP3A4 substrate | + | 0.7025 | 70.25% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.9037 | 90.37% |
CYP3A4 inhibition | - | 0.8949 | 89.49% |
CYP2C9 inhibition | - | 0.9092 | 90.92% |
CYP2C19 inhibition | - | 0.9351 | 93.51% |
CYP2D6 inhibition | - | 0.9376 | 93.76% |
CYP1A2 inhibition | - | 0.9214 | 92.14% |
CYP2C8 inhibition | - | 0.7762 | 77.62% |
CYP inhibitory promiscuity | - | 0.8900 | 89.00% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Non-required | 0.5406 | 54.06% |
Eye corrosion | - | 0.9900 | 99.00% |
Eye irritation | - | 0.9407 | 94.07% |
Skin irritation | - | 0.5363 | 53.63% |
Skin corrosion | - | 0.9392 | 93.92% |
Ames mutagenesis | - | 0.6624 | 66.24% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7657 | 76.57% |
Micronuclear | - | 0.8100 | 81.00% |
Hepatotoxicity | - | 0.7926 | 79.26% |
skin sensitisation | - | 0.9064 | 90.64% |
Respiratory toxicity | + | 0.9111 | 91.11% |
Reproductive toxicity | + | 0.9222 | 92.22% |
Mitochondrial toxicity | + | 0.7125 | 71.25% |
Nephrotoxicity | - | 0.8134 | 81.34% |
Acute Oral Toxicity (c) | I | 0.7811 | 78.11% |
Estrogen receptor binding | + | 0.7185 | 71.85% |
Androgen receptor binding | + | 0.8181 | 81.81% |
Thyroid receptor binding | - | 0.5933 | 59.33% |
Glucocorticoid receptor binding | + | 0.6930 | 69.30% |
Aromatase binding | + | 0.6728 | 67.28% |
PPAR gamma | + | 0.5476 | 54.76% |
Honey bee toxicity | - | 0.6655 | 66.55% |
Biodegradation | - | 0.7000 | 70.00% |
Crustacea aquatic toxicity | + | 0.6100 | 61.00% |
Fish aquatic toxicity | + | 0.9474 | 94.74% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
31.6 nM |
Potency |
via Super-PRED
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
70.8 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.36% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.17% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.56% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 95.17% | 100.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.41% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.66% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.50% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.70% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.78% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.73% | 95.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.66% | 82.69% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.06% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.38% | 94.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.74% | 96.43% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.54% | 81.11% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.46% | 97.36% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.16% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.35% | 99.23% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 82.23% | 91.38% |
CHEMBL2581 | P07339 | Cathepsin D | 82.05% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.49% | 95.89% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.42% | 92.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.25% | 97.25% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.96% | 97.14% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.64% | 90.71% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.04% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 205840 |
NPASS | NPC199428 |
LOTUS | LTS0196909 |
wikiData | Q105291017 |