Gs-39783
Internal ID | 757d11e4-3481-4661-aaa1-952287ef25a5 |
Taxonomy | Organosulfur compounds > Thioethers > Aryl thioethers |
IUPAC Name | 4-N,6-N-dicyclopentyl-2-methylsulfanyl-5-nitropyrimidine-4,6-diamine |
SMILES (Canonical) | CSC1=NC(=C(C(=N1)NC2CCCC2)[N+](=O)[O-])NC3CCCC3 |
SMILES (Isomeric) | CSC1=NC(=C(C(=N1)NC2CCCC2)[N+](=O)[O-])NC3CCCC3 |
InChI | InChI=1S/C15H23N5O2S/c1-23-15-18-13(16-10-6-2-3-7-10)12(20(21)22)14(19-15)17-11-8-4-5-9-11/h10-11H,2-9H2,1H3,(H2,16,17,18,19) |
InChI Key | GSGVDKOCBKBMGG-UHFFFAOYSA-N |
Popularity | 92 references in papers |
Molecular Formula | C15H23N5O2S |
Molecular Weight | 337.40 g/mol |
Exact Mass | 337.15724617 g/mol |
Topological Polar Surface Area (TPSA) | 121.00 Ų |
XlogP | 5.20 |
Atomic LogP (AlogP) | 3.82 |
H-Bond Acceptor | 7 |
H-Bond Donor | 2 |
Rotatable Bonds | 6 |
GS 39783 |
N4,N6-dicyclopentyl-2-(methylthio)-5-nitropyrimidine-4,6-diamine |
GS39783 |
GS-39783 |
HD3T22A5DM |
4-N,6-N-dicyclopentyl-2-methylsulfanyl-5-nitropyrimidine-4,6-diamine |
N,N'-Dicyclopentyl-2-(methylthio)-5- nitro-4,6-pyrimidinediamine |
N,N'-Dicyclopentyl-2-(methylthio)-5-nitro-4,6-pyrimidinediamine |
N4,N6-Dicyclopentyl-2-(methylthio)-5-nitro-4,6-pyrimidinediamine |
N,N'-Dicyclopentyl-2-methylsulfanyl-5-nitro-pyrimidine-4,6-diamine |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9656 | 96.56% |
Caco-2 | - | 0.6860 | 68.60% |
Blood Brain Barrier | + | 0.8500 | 85.00% |
Human oral bioavailability | + | 0.6143 | 61.43% |
Subcellular localzation | Mitochondria | 0.4487 | 44.87% |
OATP2B1 inhibitior | - | 0.8565 | 85.65% |
OATP1B1 inhibitior | + | 0.9574 | 95.74% |
OATP1B3 inhibitior | + | 0.9394 | 93.94% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.7000 | 70.00% |
BSEP inhibitior | - | 0.7810 | 78.10% |
P-glycoprotein inhibitior | - | 0.7132 | 71.32% |
P-glycoprotein substrate | - | 0.8411 | 84.11% |
CYP3A4 substrate | - | 0.5050 | 50.50% |
CYP2C9 substrate | - | 0.6162 | 61.62% |
CYP2D6 substrate | - | 0.8650 | 86.50% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | + | 0.8948 | 89.48% |
CYP2C19 inhibition | + | 0.8994 | 89.94% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.8186 | 81.86% |
CYP inhibitory promiscuity | + | 0.5873 | 58.73% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8900 | 89.00% |
Carcinogenicity (trinary) | Non-required | 0.4204 | 42.04% |
Eye corrosion | - | 0.9754 | 97.54% |
Eye irritation | - | 0.7320 | 73.20% |
Skin irritation | - | 0.6648 | 66.48% |
Skin corrosion | - | 0.9191 | 91.91% |
Ames mutagenesis | + | 0.5400 | 54.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7693 | 76.93% |
Micronuclear | + | 0.9600 | 96.00% |
Hepatotoxicity | + | 0.6625 | 66.25% |
skin sensitisation | - | 0.7459 | 74.59% |
Respiratory toxicity | - | 0.5222 | 52.22% |
Reproductive toxicity | + | 0.8333 | 83.33% |
Mitochondrial toxicity | + | 0.8625 | 86.25% |
Nephrotoxicity | + | 0.7191 | 71.91% |
Acute Oral Toxicity (c) | III | 0.5333 | 53.33% |
Estrogen receptor binding | + | 0.6478 | 64.78% |
Androgen receptor binding | + | 0.6205 | 62.05% |
Thyroid receptor binding | + | 0.6531 | 65.31% |
Glucocorticoid receptor binding | - | 0.5052 | 50.52% |
Aromatase binding | + | 0.5370 | 53.70% |
PPAR gamma | + | 0.6219 | 62.19% |
Honey bee toxicity | - | 0.9347 | 93.47% |
Biodegradation | - | 0.8500 | 85.00% |
Crustacea aquatic toxicity | - | 0.5100 | 51.00% |
Fish aquatic toxicity | - | 0.5197 | 51.97% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
3981.07 nM |
AC50 |
via CMAUP
|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
5011.87 nM |
AC50 |
via CMAUP
|
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
1995.26 nM |
AC50 |
via CMAUP
|
CHEMBL2111463 | Q9UBS5 | GABA-B receptor |
741.31 nM |
EC50 |
via Super-PRED
|
CHEMBL2064 | Q9UBS5 | GABA-B receptor 1 |
79.43 nM |
EC50 |
via Super-PRED
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
891.3 nM 891.3 nM |
Potency Potency |
via Super-PRED
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 96.65% | 92.88% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 93.41% | 91.38% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 93.26% | 98.99% |
CHEMBL240 | Q12809 | HERG | 93.10% | 89.76% |
CHEMBL5408 | Q9UHD2 | Serine/threonine-protein kinase TBK1 | 91.83% | 90.48% |
CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 88.76% | 80.96% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 88.61% | 83.10% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.45% | 99.23% |
CHEMBL3055 | P50613 | Cyclin-dependent kinase 7 | 87.80% | 81.88% |
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 87.40% | 95.27% |
CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 87.35% | 91.73% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 86.18% | 93.03% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.17% | 90.17% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 84.48% | 89.63% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.49% | 91.24% |
CHEMBL4070 | P19784 | Casein kinase II alpha (prime) | 82.09% | 91.67% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.73% | 85.30% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.96% | 93.10% |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 80.46% | 98.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ephedra equisetina |
Ephedra intermedia |
Ephedra sinica |
PubChem | 6604928 |
NPASS | NPC293799 |
ChEMBL | CHEMBL392394 |