N-(3-hydroxy-1,2,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide
Internal ID | 670de7e8-7400-407e-a1de-dfdb351304a7 |
Taxonomy | Hydrocarbon derivatives > Tropones |
IUPAC Name | N-(3-hydroxy-1,2,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide |
SMILES (Canonical) | CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)O |
SMILES (Isomeric) | CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)O |
InChI | InChI=1S/C21H23NO6/c1-11(23)22-15-7-5-12-9-17(25)20(27-3)21(28-4)19(12)13-6-8-18(26-2)16(24)10-14(13)15/h6,8-10,15,25H,5,7H2,1-4H3,(H,22,23) |
InChI Key | JRRUSQGIRBEMRN-UHFFFAOYSA-N |
Popularity | 11 references in papers |
Molecular Formula | C21H23NO6 |
Molecular Weight | 385.40 g/mol |
Exact Mass | 385.15253745 g/mol |
Topological Polar Surface Area (TPSA) | 94.10 Ų |
XlogP | 0.70 |
MLS002703022 |
COLCHICINE,3-DESMETHYL |
dylchicine, 3-demethyl- |
Neuro_000098 |
CHEMBL1707904 |
JRRUSQGIRBEMRN-UHFFFAOYSA-N |
CCG-102468 |
N-(3-hydroxy-1,2,10-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide |
SMR001566830 |
FT-0665700 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.39% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.09% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.85% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.18% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.86% | 91.49% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 94.24% | 95.62% |
CHEMBL2535 | P11166 | Glucose transporter | 92.81% | 98.75% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.19% | 91.79% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.81% | 90.71% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.26% | 91.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.19% | 99.17% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.81% | 93.03% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.98% | 91.19% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.30% | 92.94% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.78% | 89.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.70% | 96.38% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.94% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.77% | 95.89% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.35% | 96.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.07% | 95.89% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.96% | 89.50% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.95% | 99.23% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.00% | 96.21% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 81.31% | 83.82% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.30% | 92.62% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.48% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Colchicum autumnale |
Colchicum bivonae |
Colchicum doerfleri |
Colchicum kurdicum |
Colchicum schimperi |
Colchicum szovitsii subsp. brachyphyllum |
Sandersonia aurantiaca |
PubChem | 494161 |
LOTUS | LTS0169795 |
wikiData | Q105134069 |