N-(2-Methylpropyl)octa-2,4-dienimidic acid
| Internal ID | 59ad1245-5986-414b-a10b-075cb824d6d2 |
| Taxonomy | Organic acids and derivatives > Carboximidic acids and derivatives > Carboximidic acids |
| IUPAC Name | N-(2-methylpropyl)octa-2,4-dienamide |
| SMILES (Canonical) | CCCC=CC=CC(=O)NCC(C)C |
| SMILES (Isomeric) | CCCC=CC=CC(=O)NCC(C)C |
| InChI | InChI=1S/C12H21NO/c1-4-5-6-7-8-9-12(14)13-10-11(2)3/h6-9,11H,4-5,10H2,1-3H3,(H,13,14) |
| InChI Key | VZASTVPVPUAAJK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.30 g/mol |
| Exact Mass | 195.162314293 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 3.30 |
| N-(2-Methylpropyl)octa-2,4-dienimidic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.30% | 98.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.17% | 89.34% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.41% | 96.09% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.57% | 97.29% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.43% | 96.38% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 87.15% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.95% | 99.17% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.09% | 95.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.78% | 93.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.77% | 94.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.06% | 90.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.68% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.77% | 94.45% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.60% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Piper nigrum |
| Piper sarmentosum |
| Zanthoxylum zanthoxyloides |
| PubChem | 579797 |
| LOTUS | LTS0002796 |
| wikiData | Q82923768 |