Miscanthoside
Internal ID | d8072de7-f2eb-4924-9ae5-d351538176af |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)CO)O)O)O)C4=CC(=C(C=C4)O)O |
SMILES (Isomeric) | C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)CO)O)O)O)C4=CC(=C(C=C4)O)O |
InChI | InChI=1S/C21H22O11/c22-7-16-18(27)19(28)20(29)21(32-16)30-9-4-12(25)17-13(26)6-14(31-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-5,14,16,18-25,27-29H,6-7H2 |
InChI Key | RAFHNDRXYHOLSH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O11 |
Molecular Weight | 450.40 g/mol |
Exact Mass | 450.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.20 |
Miscanthoside |
Eriodictyol 7-O-beta-D-glucoside |
2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
Eriodictyol 7-O-glucoside |
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-7-(beta-D-glucopyranosyloxy)-2,3-dihydro-5-hydroxy-, (S)- |
FT-0639507 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4523129 | O15056 | Synaptojanin-2 |
874 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.70% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.36% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.82% | 96.09% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.51% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 91.79% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.61% | 94.45% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.42% | 96.21% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.44% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.91% | 95.89% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.83% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.77% | 90.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.93% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.90% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.32% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.35% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.86% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.12% | 86.33% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 82.02% | 94.80% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 81.51% | 92.68% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.01% | 95.78% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 13254471 |
LOTUS | LTS0254001 |
wikiData | Q105232582 |