Mansonone C
| Internal ID | 860f7f93-e5be-40b7-9b8f-8796ddf36a7a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 3,8-dimethyl-5-propan-2-ylnaphthalene-1,2-dione |
| SMILES (Canonical) | CC1=C2C(=C(C=C1)C(C)C)C=C(C(=O)C2=O)C |
| SMILES (Isomeric) | CC1=C2C(=C(C=C1)C(C)C)C=C(C(=O)C2=O)C |
| InChI | InChI=1S/C15H16O2/c1-8(2)11-6-5-9(3)13-12(11)7-10(4)14(16)15(13)17/h5-8H,1-4H3 |
| InChI Key | GREWJSSEUGRGIT-UHFFFAOYSA-N |
| Popularity | 10 references in papers |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.115029749 g/mol |
| Topological Polar Surface Area (TPSA) | 34.10 Ų |
| XlogP | 3.40 |
| 5574-34-5 |
| 1,2-Naphthalenedione, 3,8-dimethyl-5-(1-methylethyl)- |
| CHEBI:6689 |
| CHEMBL508283 |
| 1,2-Naphthoquinone, 5-isopropyl-3,8-dimethyl- |
| 5-isopropyl-3,8-dimethyl-naphthalene-1,2-dione |
| AC1L2IZM |
| 3,8-dimethyl-5-propan-2-ylnaphthalene-1,2-dione |
| SureCN9863621 |
| SCHEMBL9863621 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 94.99% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.78% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.27% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.22% | 94.73% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 86.87% | 91.76% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 85.01% | 85.94% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.33% | 93.56% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.07% | 93.18% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.07% | 99.15% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.18% | 93.65% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.71% | 96.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.02% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Alangium chinense |
| Mansonia gagei |
| Thespesia populnea |
| Ulmus americana |
| Ulmus glabra |
| Ulmus parvifolia |
| PubChem | 21742 |
| NPASS | NPC133461 |
| ChEMBL | CHEMBL508283 |
| LOTUS | LTS0266356 |
| wikiData | Q27107297 |