Lyalosidic acid
Internal ID | 5df42e31-a16a-4b65-b986-d225d2b82d92 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | (2S,3R,4S)-3-ethenyl-4-(9H-pyrido[3,4-b]indol-1-ylmethyl)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid |
SMILES (Canonical) | C=CC1C(C(=COC1OC2C(C(C(C(O2)CO)O)O)O)C(=O)O)CC3=NC=CC4=C3NC5=CC=CC=C45 |
SMILES (Isomeric) | C=C[C@@H]1[C@@H](C(=CO[C@H]1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)C(=O)O)CC3=NC=CC4=C3NC5=CC=CC=C45 |
InChI | InChI=1S/C26H28N2O9/c1-2-12-15(9-18-20-14(7-8-27-18)13-5-3-4-6-17(13)28-20)16(24(33)34)11-35-25(12)37-26-23(32)22(31)21(30)19(10-29)36-26/h2-8,11-12,15,19,21-23,25-26,28-32H,1,9-10H2,(H,33,34)/t12-,15+,19-,21-,22+,23-,25+,26+/m1/s1 |
InChI Key | UZLBTLIRYSYTRG-PVAZCJMFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28N2O9 |
Molecular Weight | 512.50 g/mol |
Exact Mass | 512.17948047 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 1.00 |
104821-27-4 |
Lyalosidicacid |
CHEBI:184068 |
DTXSID101347238 |
(2S,3R,4S)-3-ethenyl-4-(9H-pyrido[3,4-b]indol-1-ylmethyl)-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-5-carboxylic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 97.43% | 94.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.53% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.34% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.06% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.50% | 89.00% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 91.70% | 94.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.42% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.70% | 99.23% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.63% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.63% | 98.95% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 86.62% | 96.47% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.44% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.29% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.28% | 86.33% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.85% | 94.08% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.01% | 86.92% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.72% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.48% | 95.50% |
CHEMBL220 | P22303 | Acetylcholinesterase | 83.12% | 94.45% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 82.67% | 88.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ophiorrhiza acuminata |
Ophiorrhiza japonica |
Ophiorrhiza kuroiwai |
Simira rubescens |
Simira williamsii |
Stenostomum acreanum |
PubChem | 10391678 |
LOTUS | LTS0123537 |
wikiData | Q104399113 |