Luteolin 8-C-E-propenoic acid
| Internal ID | 1ccf10c3-7b4b-43b8-8911-bfcc34935f8f |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones |
| IUPAC Name | (E)-3-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-8-yl]prop-2-enoic acid |
| SMILES (Canonical) | C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C(=C3O2)C=CC(=O)O)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C(=C3O2)/C=C/C(=O)O)O)O)O)O |
| InChI | InChI=1S/C18H12O8/c19-10-3-1-8(5-12(10)21)15-7-14(23)17-13(22)6-11(20)9(18(17)26-15)2-4-16(24)25/h1-7,19-22H,(H,24,25)/b4-2+ |
| InChI Key | DBBLAWYMYVZKML-DUXPYHPUSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H12O8 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.05321734 g/mol |
| Topological Polar Surface Area (TPSA) | 145.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 94.45% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.36% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.49% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.97% | 99.15% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.07% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.86% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.79% | 86.33% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.52% | 91.71% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 85.06% | 89.23% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 84.54% | 91.73% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.91% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.04% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Afrocarpus gracilior |
| Agave xylonacantha |
| Anthemis cretica |
| Antiphiona pinnatisecta |
| Calophyllum inophyllum |
| Lycopodium japonicum |
| Maackia tashiroi |
| Monoon cupulare |
| Thelypteris esquirolii |
| Turnera diffusa |
| PubChem | 16109839 |
| NPASS | NPC115289 |
| LOTUS | LTS0073191 |
| wikiData | Q104974216 |