Leucocyanidin
| Internal ID | 51aa9aff-35c4-41e6-979a-6a5b04bbe84d |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Catechins |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,5,7-tetrol |
| SMILES (Canonical) | C1=CC(=C(C=C1C2C(C(C3=C(C=C(C=C3O2)O)O)O)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1C2C(C(C3=C(C=C(C=C3O2)O)O)O)O)O)O |
| InChI | InChI=1S/C15H14O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,13-21H |
| InChI Key | SBZWTSHAFILOTE-UHFFFAOYSA-N |
| Popularity | 674 references in papers |
| Molecular Formula | C15H14O7 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.07395278 g/mol |
| Topological Polar Surface Area (TPSA) | 131.00 Ų |
| XlogP | -0.80 |
| Leucocianidol |
| Procyanidol |
| 480-17-1 |
| CHEBI:15758 |
| 27015-21-0 |
| 2,3-trans-3,4-trans-leucocyanidin |
| SCHEMBL285598 |
| CHEMBL123809 |
| NSC84278 |
| NSC98945 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.39% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.02% | 91.49% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 96.44% | 83.82% |
| CHEMBL3194 | P02766 | Transthyretin | 91.53% | 90.71% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 88.22% | 93.40% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.85% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.66% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.45% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.31% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.77% | 94.73% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.74% | 97.09% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 81.57% | 96.12% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| Cassia javanica |
| Euphorbia hirta |
| Gossypium hirsutum |
| Musa × paradisiaca |
| PubChem | 71629 |
| LOTUS | LTS0181482 |
| wikiData | Q61014519 |