Leosibiricin
Internal ID | 3364e293-b03f-4204-b48b-db8e76d04690 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Alpha-acyloxy carbonyl compounds > Alpha-acyloxy ketones |
IUPAC Name | |
SMILES (Canonical) | CC(=O)OC1(C(=O)C2C3C(CCCC3(C14CCC5(O4)COC=C5)C)(C(=O)O2)C)C |
SMILES (Isomeric) | CC(=O)O[C@]1(C(=O)[C@@H]2[C@H]3[C@](CCC[C@@]3([C@]14CC[C@]5(O4)COC=C5)C)(C(=O)O2)C)C |
InChI | InChI=1S/C22H28O7/c1-13(23)28-20(4)16(24)14-15-18(2,17(25)27-14)6-5-7-19(15,3)22(20)9-8-21(29-22)10-11-26-12-21/h10-11,14-15H,5-9,12H2,1-4H3/t14-,15-,18-,19-,20-,21+,22+/m0/s1 |
InChI Key | NEDHMGGDODFBIE-VNWXRZPYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H28O7 |
Molecular Weight | 404.50 g/mol |
Exact Mass | 404.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 88.10 Ų |
XlogP | 2.10 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.19% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.68% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.09% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.59% | 99.23% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.69% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.94% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 89.15% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.88% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.35% | 89.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.99% | 82.69% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.11% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.22% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.05% | 93.04% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 83.70% | 97.14% |
CHEMBL5028 | O14672 | ADAM10 | 82.74% | 97.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.27% | 95.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.62% | 94.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.39% | 96.77% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.13% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Leonurus cardiaca |
Leonurus persicus |
Leonurus sibiricus |
Wulfenia carinthiaca |
PubChem | 101944737 |
NPASS | NPC116230 |
LOTUS | LTS0235261 |
wikiData | Q105030926 |