Kiwiionoside
Internal ID | ad5d27f1-3187-4941-b21b-d9c134d38071 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | 2-[3,4-dihydroxy-4-[(E)-3-hydroxybut-1-enyl]-3,5,5-trimethylcyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC(C=CC1(C(CC(CC1(C)O)OC2C(C(C(C(O2)CO)O)O)O)(C)C)O)O |
SMILES (Isomeric) | CC(/C=C/C1(C(CC(CC1(C)O)OC2C(C(C(C(O2)CO)O)O)O)(C)C)O)O |
InChI | InChI=1S/C19H34O9/c1-10(21)5-6-19(26)17(2,3)7-11(8-18(19,4)25)27-16-15(24)14(23)13(22)12(9-20)28-16/h5-6,10-16,20-26H,7-9H2,1-4H3/b6-5+ |
InChI Key | SGUOENJPMRQEMJ-AATRIKPKSA-N |
Popularity | 4 references in papers |
Molecular Formula | C19H34O9 |
Molecular Weight | 406.50 g/mol |
Exact Mass | 406.22028266 g/mol |
Topological Polar Surface Area (TPSA) | 160.00 Ų |
XlogP | -1.50 |
Stratioside II |
SCHEMBL24482492 |
CHEBI:168221 |
2-[3,4-dihydroxy-4-[(E)-3-hydroxybut-1-enyl]-3,5,5-trimethylcyclohexyl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.46% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.95% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.74% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.17% | 85.14% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 89.14% | 95.93% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.85% | 92.86% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.90% | 96.47% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.70% | 97.09% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 86.32% | 92.32% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.44% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.29% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 83.21% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.16% | 94.45% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.97% | 93.10% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.68% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.86% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.77% | 96.21% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 80.58% | 91.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Actinidia chinensis |
Pistia stratiotes |
Rhododendron latoucheae |
PubChem | 131752431 |
LOTUS | LTS0256618 |
wikiData | Q105252642 |