Kelampayoside B
Internal ID | 2a195a30-cdb0-4691-bc4d-6f0e30c7e9d2 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | [(3S,4R,5R)-3,4-dihydroxy-5-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3,4,5-trimethoxyphenoxy)oxan-2-yl]methoxy]oxolan-3-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | COC1=CC(=CC(=C1OC)OC)OC2C(C(C(C(O2)COC3C(C(CO3)(COC(=O)C=CC4=CC(=C(C=C4)O)O)O)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1OC)OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@](CO3)(COC(=O)/C=C/C4=CC(=C(C=C4)O)O)O)O)O)O)O |
InChI | InChI=1S/C29H36O16/c1-38-18-9-15(10-19(39-2)25(18)40-3)44-27-24(35)23(34)22(33)20(45-27)11-41-28-26(36)29(37,13-43-28)12-42-21(32)7-5-14-4-6-16(30)17(31)8-14/h4-10,20,22-24,26-28,30-31,33-37H,11-13H2,1-3H3/b7-5+/t20-,22-,23+,24-,26+,27-,28-,29-/m1/s1 |
InChI Key | CKCXDLPHBUFZPH-YVQWANQJSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C29H36O16 |
Molecular Weight | 640.60 g/mol |
Exact Mass | 640.20033506 g/mol |
Topological Polar Surface Area (TPSA) | 233.00 Ų |
XlogP | -0.70 |
[(3S,4R,5R)-3,4-dihydroxy-5-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(3,4,5-trimethoxyphenoxy)oxan-2-yl]methoxy]oxolan-3-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.84% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.60% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.80% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.41% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.76% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.84% | 95.56% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 92.57% | 89.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.66% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.52% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.32% | 90.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.26% | 92.62% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 85.56% | 80.78% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.86% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.38% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.88% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.56% | 92.94% |
CHEMBL3194 | P02766 | Transthyretin | 81.91% | 90.71% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 80.62% | 91.07% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.62% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ilex macropoda |
Neolamarckia cadamba |
PubChem | 10841818 |
LOTUS | LTS0009867 |
wikiData | Q104962147 |