Kaempferol 3-(6-acetylgalactoside)
Internal ID | d4406f2d-687d-4181-8706-4880fd541bee |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | [6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC(=O)OCC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)O)O |
SMILES (Isomeric) | CC(=O)OCC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)O)O |
InChI | InChI=1S/C23H22O12/c1-9(24)32-8-15-17(28)19(30)20(31)23(34-15)35-22-18(29)16-13(27)6-12(26)7-14(16)33-21(22)10-2-4-11(25)5-3-10/h2-7,15,17,19-20,23,25-28,30-31H,8H2,1H3 |
InChI Key | AKENCGNASJPQNR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H22O12 |
Molecular Weight | 490.40 g/mol |
Exact Mass | 490.11112613 g/mol |
Topological Polar Surface Area (TPSA) | 192.00 Ų |
XlogP | 0.70 |
Kaempferol 3-(6-acetylgalactoside) |
Kaempferol-3-O-beta-D-6''-acetylglucoside |
Kaempferol 3-O-(6''-O-acetyl)glucoside |
CHEBI:197087 |
[6-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.94% | 91.11% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 97.84% | 95.64% |
CHEMBL2581 | P07339 | Cathepsin D | 97.58% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.32% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.95% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.60% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.88% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.65% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.29% | 86.33% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.54% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.22% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.16% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 83.84% | 95.78% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.65% | 94.80% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.59% | 99.15% |
CHEMBL3194 | P02766 | Transthyretin | 81.30% | 90.71% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.93% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.55% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arnica chamissonis |
Arnica longifolia |
Crocus sativus |
Picea abies |
Stachyurus himalaicus |
Trifolium resupinatum |
PubChem | 74978029 |
LOTUS | LTS0245956 |
wikiData | Q104913582 |