kadlongilactone A
Internal ID | b6fcc770-0b7c-4574-80db-1ffbb27d9e2f |
Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
IUPAC Name | (1R,2S,5R,13S,15R,18S,23R,24S,26R)-13,26-dihydroxy-1,6,6,20,24-pentamethyl-7,22-dioxahexacyclo[13.12.0.02,13.05,11.016,25.018,23]heptacosa-9,11,16(25),19-tetraene-8,21-dione |
SMILES (Canonical) | CC1C2C(CC3=C1C(CC4(C3CC5(C4CCC6C(=C5)C=CC(=O)OC6(C)C)O)C)O)C=C(C(=O)O2)C |
SMILES (Isomeric) | C[C@@H]1[C@H]2[C@@H](CC3=C1[C@@H](C[C@@]4([C@H]3C[C@]5([C@H]4CC[C@@H]6C(=C5)C=CC(=O)OC6(C)C)O)C)O)C=C(C(=O)O2)C |
InChI | InChI=1S/C30H38O6/c1-15-10-18-11-19-21-13-30(34)12-17-6-9-24(32)36-28(3,4)20(17)7-8-23(30)29(21,5)14-22(31)25(19)16(2)26(18)35-27(15)33/h6,9-10,12,16,18,20-23,26,31,34H,7-8,11,13-14H2,1-5H3/t16-,18+,20+,21-,22+,23-,26-,29+,30+/m0/s1 |
InChI Key | JDOHERDAOGEJFF-ASWXAAPUSA-N |
Popularity | 3 references in papers |
Molecular Formula | C30H38O6 |
Molecular Weight | 494.60 g/mol |
Exact Mass | 494.26683893 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 2.50 |
CHEBI:66128 |
(4aR,5S,6R,7aR,7bS,9aR,15aS,16aR,17aS)-6,15a-dihydroxy-2,5,7a,10,10-pentamethyl-5,6,7,7a,7b,8,9,9a,10,15a,16,16a,17,17a-tetradecahydro-3H-oxepino[4'',3'':4',5']cyclohepta[1',2':1,2]indeno[4,5-g]chromene-3,12(4aH)-dione |
869299-81-0 |
kadlongilactoneA |
CHEMBL404848 |
Q27134649 |
(1R,2S,5R,13S,15R,18S,23R,24S,26R)-13,26-dihydroxy-1,6,6,20,24-pentamethyl-7,22-dioxahexacyclo[13.12.0.02,13.05,11.016,25.018,23]heptacosa-9,11,16(25),19-tetraene-8,21-dione |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.85% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.30% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 90.32% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.78% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.66% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.26% | 97.25% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 85.63% | 94.80% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 84.69% | 97.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.13% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.77% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.59% | 95.89% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 81.45% | 87.67% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.83% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.25% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kadsura coccinea |
Kadsura longepedunculata |
PubChem | 11648913 |
LOTUS | LTS0043352 |
wikiData | Q27134649 |