Jaceoside
Internal ID | daad5786-1965-4404-8126-eeb2fb359e89 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC4C(C(C(C(O4)CO)O)O)O)OC)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC)O)O |
InChI | InChI=1S/C23H24O12/c1-31-13-5-9(3-4-10(13)25)12-6-11(26)17-14(33-12)7-15(22(32-2)19(17)28)34-23-21(30)20(29)18(27)16(8-24)35-23/h3-7,16,18,20-21,23-25,27-30H,8H2,1-2H3/t16-,18-,20+,21-,23-/m1/s1 |
InChI Key | YFZSQPRYLBGYKE-FZFRBNDOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C23H24O12 |
Molecular Weight | 492.40 g/mol |
Exact Mass | 492.12677620 g/mol |
Topological Polar Surface Area (TPSA) | 185.00 Ų |
XlogP | 0.80 |
25474-11-7 |
CHEMBL515459 |
DTXSID30904224 |
AKOS040735199 |
NCGC00384867-01!5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.57% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.40% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.48% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.19% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.09% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.51% | 99.15% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.99% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.80% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 90.30% | 86.92% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 89.96% | 96.21% |
CHEMBL220 | P22303 | Acetylcholinesterase | 88.19% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.09% | 99.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.61% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 85.29% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.98% | 94.73% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.38% | 95.64% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.77% | 94.45% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.93% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.56% | 96.00% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.49% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Adenothamnus validus |
Arnica chamissonis |
Artemisia argyi |
Centaurea virgata |
Eriocaulon buergerianum |
Iris domestica |
Kickxia elatine |
Leiothrix flavescens |
Paronychia argentea |
PubChem | 11179379 |
LOTUS | LTS0084893 |
wikiData | Q82873469 |