Hydroxynorcytisine
| Internal ID | 5990a67f-5508-47ab-94f8-fa8a1434aeaa |
| Taxonomy | Organoheterocyclic compounds > Pyridodiazepines |
| IUPAC Name | (1S,9S)-5-hydroxy-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one |
| SMILES (Canonical) | C1C2CNC1C3=CC=C(C(=O)N3C2)O |
| SMILES (Isomeric) | C1[C@H]2CN[C@@H]1C3=CC=C(C(=O)N3C2)O |
| InChI | InChI=1S/C10H12N2O2/c13-9-2-1-8-7-3-6(4-11-7)5-12(8)10(9)14/h1-2,6-7,11,13H,3-5H2/t6-,7-/m0/s1 |
| InChI Key | AFTDVOKQJZAVLI-BQBZGAKWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.089877630 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | -0.20 |
| NS00094237 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 94.78% | 91.76% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.57% | 97.09% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.66% | 93.40% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.80% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.60% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.13% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.02% | 93.99% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.14% | 90.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.46% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 83.75% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.66% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.21% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.87% | 99.15% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.24% | 94.45% |
| CHEMBL1907588 | P02708 | Acetylcholine receptor; alpha1/beta1/delta/gamma | 80.61% | 98.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.06% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Amaranthus spinosus |
| Laburnum anagyroidis |
| Piper dilatatum |
| PubChem | 25171260 |
| NPASS | NPC13467 |
| LOTUS | LTS0245913 |
| wikiData | Q104911555 |