hydron;1H-indole
| Internal ID | 81c3d957-dede-43df-b309-135c5d41d901 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives |
| IUPAC Name | hydron;1H-indole |
| SMILES (Canonical) | [H+].C1=CC=C2C(=C1)C=CN2 |
| SMILES (Isomeric) | [H+].C1=CC=C2C(=C1)C=CN2 |
| InChI | InChI=1S/C8H7N/c1-2-4-8-7(3-1)5-6-9-8/h1-6,9H/p+1 |
| InChI Key | SIKJAQJRHWYJAI-UHFFFAOYSA-O |
| Popularity | 0 references in papers |
| Molecular Formula | C8H8N+ |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.065674259 g/mol |
| Topological Polar Surface Area (TPSA) | 15.80 Ų |
| XlogP | 0.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.86% | 91.11% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 92.80% | 97.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.59% | 95.56% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 84.77% | 88.56% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.17% | 94.62% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 83.16% | 81.14% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.65% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Camellia sinensis |
| Chimonanthus praecox |
| Isatis tinctoria |
| Strobilanthes cusia |