Hispidulin 7-sulfate
| Internal ID | 1c738e63-0912-446b-bcf0-a403702c466c |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 6-O-methylated flavonoids |
| IUPAC Name | [5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-4-oxochromen-7-yl] hydrogen sulfate |
| SMILES (Canonical) | COC1=C(C=C2C(=C1O)C(=O)C=C(O2)C3=CC=C(C=C3)O)OS(=O)(=O)O |
| SMILES (Isomeric) | COC1=C(C=C2C(=C1O)C(=O)C=C(O2)C3=CC=C(C=C3)O)OS(=O)(=O)O |
| InChI | InChI=1S/C16H12O9S/c1-23-16-13(25-26(20,21)22)7-12-14(15(16)19)10(18)6-11(24-12)8-2-4-9(17)5-3-8/h2-7,17,19H,1H3,(H,20,21,22) |
| InChI Key | WONZXVKRFAHSAK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H12O9S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.02020313 g/mol |
| Topological Polar Surface Area (TPSA) | 148.00 Ų |
| XlogP | 1.10 |
| CHEBI:185482 |
| LMPK12111171 |
| [5-hydroxy-2-(4-hydroxyphenyl)-6-methoxy-4-oxochromen-7-yl] hydrogen sulate |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.80% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.00% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.23% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.78% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.71% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.67% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.62% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.34% | 94.45% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.38% | 94.73% |
| CHEMBL3194 | P02766 | Transthyretin | 86.92% | 90.71% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 85.75% | 83.57% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.08% | 99.15% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.50% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Carthamus tinctorius |
| Iphiona scabra |
| Phyla nodiflora |
| PubChem | 13831736 |
| LOTUS | LTS0244361 |
| wikiData | Q104919703 |