Hippeastrine (Hydrobromide)
Internal ID | 652bdf24-9224-49e5-b9e2-72055b68f071 |
Taxonomy | Alkaloids and derivatives > Amaryllidaceae alkaloids > Homolycorine-type amaryllidaceae alkaloids |
IUPAC Name | 9-hydroxy-4-methyl-11,16,18-trioxa-4-azapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),7,13,15(19)-tetraen-12-one |
SMILES (Canonical) | CN1CCC2=CC(C3C(C21)C4=CC5=C(C=C4C(=O)O3)OCO5)O |
SMILES (Isomeric) | CN1CCC2=CC(C3C(C21)C4=CC5=C(C=C4C(=O)O3)OCO5)O |
InChI | InChI=1S/C17H17NO5/c1-18-3-2-8-4-11(19)16-14(15(8)18)9-5-12-13(22-7-21-12)6-10(9)17(20)23-16/h4-6,11,14-16,19H,2-3,7H2,1H3 |
InChI Key | DGQPIOQRPAGNGB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H17NO5 |
Molecular Weight | 315.32 g/mol |
Exact Mass | 315.11067264 g/mol |
Topological Polar Surface Area (TPSA) | 68.20 Ų |
XlogP | 0.70 |
Trispherine |
DGQPIOQRPAGNGB-UHFFFAOYSA-N |
Lycorenan-7-one, 5-hydroxy-1-methyl-9,10-[methylenebis(oxy)]-, (5.alpha.)- |
Lycorenan-9-one, 6-hydroxy-1-methyl-12,13-[methylenebis(oxy)]-, (6.alpha.)- |
5-Hydroxy-1-methyl-2,3,5,5a,12b,12c-hexahydro[1,3]dioxolo[4',5':6,7]isochromeno[3,4-g]indol-7(1H)-one # |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.33% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.83% | 95.56% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.45% | 93.40% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.33% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.09% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.11% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.12% | 91.11% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.31% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.37% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.44% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.15% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.56% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.41% | 90.00% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.82% | 98.46% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.63% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.17% | 99.23% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.60% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 580552 |
LOTUS | LTS0136506 |
wikiData | Q104979090 |