Heteroflavanone B
Internal ID | a7fb47e5-4914-4007-b5cd-8a7402071eca |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans > 8-prenylated flavanones |
IUPAC Name | 5-hydroxy-7-methoxy-8-(3-methylbut-2-enyl)-2-(2,4,6-trimethoxyphenyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C=C(C2=C1OC(CC2=O)C3=C(C=C(C=C3OC)OC)OC)O)OC)C |
SMILES (Isomeric) | CC(=CCC1=C(C=C(C2=C1OC(CC2=O)C3=C(C=C(C=C3OC)OC)OC)O)OC)C |
InChI | InChI=1S/C24H28O7/c1-13(2)7-8-15-18(28-4)11-16(25)22-17(26)12-21(31-24(15)22)23-19(29-5)9-14(27-3)10-20(23)30-6/h7,9-11,21,25H,8,12H2,1-6H3 |
InChI Key | CQHDMUSZBYPHBO-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C24H28O7 |
Molecular Weight | 428.50 g/mol |
Exact Mass | 428.18350323 g/mol |
Topological Polar Surface Area (TPSA) | 83.40 Ų |
XlogP | 4.90 |
CHEBI:169821 |
LMPK12140479 |
5-Hydroxy-2',4',6',7-tetramethoxy-8-prenylflavanone |
8-(gamma,gamma-dimethylallyl)5-hydroxy-7,2',4',6'-tetramethoxyflavanone |
5-hydroxy-7-methoxy-8-(3-methylbut-2-enyl)-2-(2,4,6-trimethoxyphenyl)-2,3-dihydrochromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.13% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.20% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.01% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.67% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.78% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.29% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.88% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.82% | 98.95% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.41% | 92.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.21% | 85.14% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.99% | 86.33% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.42% | 96.12% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.34% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.28% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.09% | 99.15% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.63% | 91.07% |
CHEMBL240 | Q12809 | HERG | 84.09% | 89.76% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.96% | 92.94% |
CHEMBL2535 | P11166 | Glucose transporter | 82.31% | 98.75% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.49% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.44% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.98% | 93.99% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.48% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus heterophyllus |
Artocarpus integer |
PubChem | 42608026 |
LOTUS | LTS0036287 |
wikiData | Q104402560 |