Gnetinc
Internal ID | 521126e3-c53e-413b-9b6e-f56e007e5c62 |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 5-[(2R,3R)-4-hydroxy-2-(4-hydroxyphenyl)-6-[(E)-2-(4-hydroxyphenyl)ethenyl]-2,3-dihydro-1-benzofuran-3-yl]benzene-1,3-diol |
SMILES (Canonical) | C1=CC(=CC=C1C=CC2=CC(=C3C(C(OC3=C2)C4=CC=C(C=C4)O)C5=CC(=CC(=C5)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C2=CC(=C3[C@H]([C@@H](OC3=C2)C4=CC=C(C=C4)O)C5=CC(=CC(=C5)O)O)O)O |
InChI | InChI=1S/C28H22O6/c29-20-7-3-16(4-8-20)1-2-17-11-24(33)27-25(12-17)34-28(18-5-9-21(30)10-6-18)26(27)19-13-22(31)15-23(32)14-19/h1-15,26,28-33H/b2-1+/t26-,28+/m1/s1 |
InChI Key | KVGHRSAHESCTFR-PXXWLXOCSA-N |
Popularity | 13 references in papers |
Molecular Formula | C28H22O6 |
Molecular Weight | 454.50 g/mol |
Exact Mass | 454.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 110.00 Ų |
XlogP | 5.40 |
GNETINC |
SCHEMBL22895127 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.27% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.70% | 91.49% |
CHEMBL3194 | P02766 | Transthyretin | 93.76% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.86% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.08% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.87% | 94.73% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.02% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.67% | 93.99% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.94% | 96.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.08% | 83.82% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cyphostemma crotalarioides |
Gnetum africanum |
Gnetum gnemon |
Gnetum gnemonoides |
Gnetum klossii |
Gnetum latifolium |
Gnetum schwackeanum |
Gnetum venosum |
Rheum racemiferum |
PubChem | 100920621 |
LOTUS | LTS0083026 |
wikiData | Q104402808 |