Glycozoline
Internal ID | 71ac2faf-fb29-4505-92f1-1f79552dd554 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | 3-methoxy-6-methyl-9H-carbazole |
SMILES (Canonical) | CC1=CC2=C(C=C1)NC3=C2C=C(C=C3)OC |
SMILES (Isomeric) | CC1=CC2=C(C=C1)NC3=C2C=C(C=C3)OC |
InChI | InChI=1S/C14H13NO/c1-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14(12)15-13/h3-8,15H,1-2H3 |
InChI Key | GQGQTPKMCGBOKG-UHFFFAOYSA-N |
Popularity | 27 references in papers |
Molecular Formula | C14H13NO |
Molecular Weight | 211.26 g/mol |
Exact Mass | 211.099714038 g/mol |
Topological Polar Surface Area (TPSA) | 25.00 Ų |
XlogP | 3.70 |
3-methoxy-6-methyl-9H-carbazole |
5234-30-0 |
9H-Carbazole,3-methoxy-6-methyl- |
9H-Carbazole, 3-methoxy-6-methyl- |
NSC 94934 |
CHEMBL2260669 |
SCHEMBL11981403 |
DTXSID90200370 |
NSC94934 |
NSC-94934 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.67% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.99% | 95.56% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.42% | 93.99% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.84% | 96.09% |
CHEMBL1907 | P15144 | Aminopeptidase N | 89.91% | 93.31% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.98% | 94.45% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.39% | 94.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.29% | 93.18% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 88.14% | 91.71% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.04% | 85.49% |
CHEMBL2535 | P11166 | Glucose transporter | 85.63% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.94% | 90.00% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 84.37% | 96.47% |
CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.61% | 93.24% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.09% | 92.94% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.35% | 94.62% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 81.11% | 100.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.77% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clausena lansium |
Glycosmis macrophylla |
Glycosmis mauritiana |
Glycosmis pentaphylla |
Murraya koenigii |
PubChem | 96944 |
LOTUS | LTS0070628 |
wikiData | Q83073468 |