Glycomaurrol
| Internal ID | b31f444b-097e-4daa-b98d-e2ec07a6923e |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 6-methyl-4-(3-methylbut-2-enyl)-9H-carbazol-3-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H19NO/c1-11(2)4-6-13-17(20)9-8-16-18(13)14-10-12(3)5-7-15(14)19-16/h4-5,7-10,19-20H,6H2,1-3H3 |
| InChI Key | SHNRPNUTQQJVJO-UHFFFAOYSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.146664230 g/mol |
| Topological Polar Surface Area (TPSA) | 36.00 Ų |
| XlogP | 5.30 |
| 6-methyl-4-(3-methylbut-2-enyl)-9H-carbazol-3-ol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.07% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.33% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.72% | 91.49% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 94.71% | 91.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.03% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.88% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.10% | 94.73% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.61% | 85.14% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.23% | 94.75% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.26% | 97.21% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 85.34% | 95.56% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.92% | 98.59% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.21% | 94.62% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.67% | 89.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.59% | 89.62% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.78% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.39% | 93.99% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.16% | 91.79% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.67% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycosmis mauritiana |
| Glycosmis pentaphylla |
| PubChem | 13996081 |
| LOTUS | LTS0037229 |
| wikiData | Q105253087 |