[(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-22-[(Z)-2-methylbut-2-enoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-13-yl] (2R)-2-methylbutanoate
Internal ID | 67c8843e-1b38-4838-bda4-9182765a87ba |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal alkaloids > Cerveratrum-type alkaloids |
IUPAC Name | [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-22-[(Z)-2-methylbut-2-enoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-13-yl] (2R)-2-methylbutanoate |
SMILES (Canonical) | CCC(C)C(=O)OC1C(C2C(CN3CC(CCC3C2(C)O)C)C4C1(C5C(CC6C7(C5(C4)OC6(C(CC7)OC(=O)C(=CC)C)O)C)OC(=O)C)O)O |
SMILES (Isomeric) | CC[C@@H](C)C(=O)O[C@H]1[C@@H]([C@H]2[C@@H](CN3C[C@H](CC[C@H]3[C@@]2(C)O)C)[C@H]4[C@@]1([C@@H]5[C@@H](C[C@H]6[C@]7([C@]5(C4)O[C@@]6([C@H](CC7)OC(=O)/C(=C\C)/C)O)C)OC(=O)C)O)O |
InChI | InChI=1S/C39H59NO11/c1-9-20(4)33(43)49-28-13-14-35(7)26-15-25(48-22(6)41)31-37(35,51-39(26,28)47)16-24-23-18-40-17-19(3)11-12-27(40)36(8,45)29(23)30(42)32(38(24,31)46)50-34(44)21(5)10-2/h9,19,21,23-32,42,45-47H,10-18H2,1-8H3/b20-9-/t19-,21+,23-,24-,25+,26-,27-,28-,29+,30+,31+,32-,35-,36+,37+,38-,39-/m0/s1 |
InChI Key | JDCJBUJXKILORV-ALXDFGSNSA-N |
Popularity | 4 references in papers |
Molecular Formula | C39H59NO11 |
Molecular Weight | 717.90 g/mol |
Exact Mass | 717.40881170 g/mol |
Topological Polar Surface Area (TPSA) | 172.00 Ų |
XlogP | 3.30 |
Atomic LogP (AlogP) | 2.87 |
H-Bond Acceptor | 12 |
H-Bond Donor | 4 |
Rotatable Bonds | 6 |
639-11-2 |
DTXSID801346762 |
![2D Structure of [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-22-[(Z)-2-methylbut-2-enoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-13-yl] (2R)-2-methylbutanoate 2D Structure of [(1S,2S,6S,9S,10S,11R,12R,13S,14S,15S,16R,18S,19S,22S,23S,25R)-16-acetyloxy-10,12,14,23-tetrahydroxy-6,10,19-trimethyl-22-[(Z)-2-methylbut-2-enoyl]oxy-24-oxa-4-azaheptacyclo[12.12.0.02,11.04,9.015,25.018,23.019,25]hexacosan-13-yl] (2R)-2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/07/germanitrine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7900 | 79.00% |
Caco-2 | - | 0.8495 | 84.95% |
Blood Brain Barrier | + | 0.8000 | 80.00% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Mitochondria | 0.4552 | 45.52% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8928 | 89.28% |
OATP1B3 inhibitior | + | 0.9403 | 94.03% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | - | 0.8250 | 82.50% |
BSEP inhibitior | + | 0.8778 | 87.78% |
P-glycoprotein inhibitior | + | 0.7649 | 76.49% |
P-glycoprotein substrate | + | 0.6939 | 69.39% |
CYP3A4 substrate | + | 0.7418 | 74.18% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8447 | 84.47% |
CYP3A4 inhibition | - | 0.8977 | 89.77% |
CYP2C9 inhibition | - | 0.8874 | 88.74% |
CYP2C19 inhibition | - | 0.8922 | 89.22% |
CYP2D6 inhibition | - | 0.9241 | 92.41% |
CYP1A2 inhibition | - | 0.8925 | 89.25% |
CYP2C8 inhibition | + | 0.7069 | 70.69% |
CYP inhibitory promiscuity | - | 0.9033 | 90.33% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.9900 | 99.00% |
Carcinogenicity (trinary) | Danger | 0.4590 | 45.90% |
Eye corrosion | - | 0.9876 | 98.76% |
Eye irritation | - | 0.9169 | 91.69% |
Skin irritation | - | 0.7213 | 72.13% |
Skin corrosion | - | 0.9261 | 92.61% |
Ames mutagenesis | - | 0.6038 | 60.38% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4703 | 47.03% |
Micronuclear | + | 0.5800 | 58.00% |
Hepatotoxicity | + | 0.5197 | 51.97% |
skin sensitisation | - | 0.8619 | 86.19% |
Respiratory toxicity | + | 0.6222 | 62.22% |
Reproductive toxicity | + | 0.9333 | 93.33% |
Mitochondrial toxicity | + | 0.9625 | 96.25% |
Nephrotoxicity | + | 0.6013 | 60.13% |
Acute Oral Toxicity (c) | I | 0.4839 | 48.39% |
Estrogen receptor binding | + | 0.7520 | 75.20% |
Androgen receptor binding | + | 0.7540 | 75.40% |
Thyroid receptor binding | - | 0.5667 | 56.67% |
Glucocorticoid receptor binding | + | 0.7160 | 71.60% |
Aromatase binding | + | 0.7023 | 70.23% |
PPAR gamma | + | 0.7550 | 75.50% |
Honey bee toxicity | - | 0.6481 | 64.81% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.5445 | 54.45% |
Fish aquatic toxicity | + | 0.9250 | 92.50% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.30% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.22% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.00% | 94.45% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 93.92% | 89.05% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 93.23% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 92.37% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.06% | 86.33% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.89% | 90.17% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.62% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.22% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.08% | 97.09% |
CHEMBL299 | P17252 | Protein kinase C alpha | 89.92% | 98.03% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 89.65% | 95.36% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 89.16% | 97.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.06% | 95.89% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 88.60% | 99.17% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.55% | 93.00% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 88.34% | 95.00% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.29% | 89.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 87.96% | 97.28% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 87.44% | 82.50% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.27% | 94.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.11% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.83% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.79% | 89.00% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.50% | 95.58% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.43% | 91.24% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.31% | 95.17% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 83.82% | 97.79% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.59% | 92.98% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.56% | 93.56% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.48% | 98.75% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.38% | 91.03% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.34% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.31% | 91.19% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.92% | 96.90% |
CHEMBL3837 | P07711 | Cathepsin L | 81.84% | 96.61% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.83% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.79% | 96.47% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.73% | 91.11% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.49% | 92.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.29% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.22% | 99.23% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.14% | 95.50% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.70% | 97.50% |
CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.57% | 97.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.14% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Veratrum album |
Veratrum fimbriatum |
Veratrum maackii |
Veratrum nigrum |
PubChem | 101306698 |
NPASS | NPC173572 |
LOTUS | LTS0036451 |
wikiData | Q105133351 |