gamma-Taraxastanonol
Internal ID | fb4cccb2-5eea-4bfd-85b0-15bbf42d32fb |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 11-hydroxy-4,4,6a,6b,8a,11,12,14b-octamethyl-2,4a,5,6,6a,7,8,9,10,12,12a,13,14,14a-tetradecahydro-1H-picen-3-one |
SMILES (Canonical) | CC1C2C3CCC4C5(CCC(=O)C(C5CCC4(C3(CCC2(CCC1(C)O)C)C)C)(C)C)C |
SMILES (Isomeric) | CC1C2C3CCC4C5(CCC(=O)C(C5CCC4(C3(CCC2(CCC1(C)O)C)C)C)(C)C)C |
InChI | InChI=1S/C30H50O2/c1-19-24-20-9-10-22-27(5)13-12-23(31)25(2,3)21(27)11-14-29(22,7)28(20,6)17-15-26(24,4)16-18-30(19,8)32/h19-22,24,32H,9-18H2,1-8H3 |
InChI Key | VCUCVBNQZJFUDR-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C30H50O2 |
Molecular Weight | 442.70 g/mol |
Exact Mass | 442.381080833 g/mol |
Topological Polar Surface Area (TPSA) | 37.30 Ų |
XlogP | 8.00 |
gamma-Taraxastanonol |
20-Hydroxy-3-taraxastanone |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.11% | 92.94% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.25% | 97.25% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 90.46% | 82.69% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.62% | 94.75% |
CHEMBL204 | P00734 | Thrombin | 88.56% | 96.01% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.47% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.90% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.48% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 85.72% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.24% | 96.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.55% | 93.03% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.09% | 91.24% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.00% | 93.04% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.58% | 94.45% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 81.55% | 85.30% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.11% | 91.11% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.14% | 90.71% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.02% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Mangifera indica |
Protium heptaphyllum |
PubChem | 14357350 |
LOTUS | LTS0227692 |
wikiData | Q105283954 |