2-[4-Hydroxy-6-(hydroxymethyl)-2-[[6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 3c1385d8-f9cf-4a8c-a1a8-c8f4f0960528 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4-hydroxy-6-(hydroxymethyl)-2-[[6-methoxy-7,9,13-trimethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)OC |
SMILES (Isomeric) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)O)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)OC |
InChI | InChI=1S/C52H86O23/c1-21(20-67-46-40(62)38(60)35(57)30(17-53)70-46)9-14-52(66-6)22(2)33-29(75-52)16-28-26-8-7-24-15-25(10-12-50(24,4)27(26)11-13-51(28,33)5)69-49-45(74-47-41(63)37(59)34(56)23(3)68-47)43(65)44(32(19-55)72-49)73-48-42(64)39(61)36(58)31(18-54)71-48/h7,21-23,25-49,53-65H,8-20H2,1-6H3 |
InChI Key | WMQWOVNVLJJJIH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C52H86O23 |
Molecular Weight | 1079.20 g/mol |
Exact Mass | 1078.55598899 g/mol |
Topological Polar Surface Area (TPSA) | 355.00 Ų |
XlogP | -1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.06% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.70% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.74% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.35% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.83% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.75% | 94.45% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.16% | 89.05% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.98% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.33% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.35% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 89.00% | 98.95% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.81% | 93.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.68% | 89.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.61% | 96.61% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 87.06% | 94.08% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.92% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.33% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.07% | 94.75% |
CHEMBL237 | P41145 | Kappa opioid receptor | 84.81% | 98.10% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.52% | 98.46% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.23% | 98.05% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.00% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.40% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.15% | 94.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.27% | 96.43% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.19% | 92.86% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.69% | 93.18% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.67% | 97.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea villosa |
Lactuca sativa |
Lactuca triangulata |
Lilium candidum |
Lilium longiflorum |
Rhapis humilis |
Sabal causiarum |
PubChem | 14080167 |
LOTUS | LTS0102967 |
wikiData | Q105383875 |