Eustomin
Internal ID | c4eae7ac-3e1a-4713-959b-e7796a2f1040 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 8-hydroxy-1,2,3,4,6-pentamethoxyxanthen-9-one |
SMILES (Canonical) | COC1=CC(=C2C(=C1)OC3=C(C2=O)C(=C(C(=C3OC)OC)OC)OC)O |
SMILES (Isomeric) | COC1=CC(=C2C(=C1)OC3=C(C2=O)C(=C(C(=C3OC)OC)OC)OC)O |
InChI | InChI=1S/C18H18O8/c1-21-8-6-9(19)11-10(7-8)26-15-12(13(11)20)14(22-2)16(23-3)18(25-5)17(15)24-4/h6-7,19H,1-5H3 |
InChI Key | SVEPSJMWTARFFE-UHFFFAOYSA-N |
Popularity | 8 references in papers |
Molecular Formula | C18H18O8 |
Molecular Weight | 362.30 g/mol |
Exact Mass | 362.10016753 g/mol |
Topological Polar Surface Area (TPSA) | 92.70 Ų |
XlogP | 3.00 |
63504-29-0 |
1-Hydroxy-3,5,6,7,8-pentamethoxyxanthone |
8-hydroxy-1,2,3,4,6-pentamethoxyxanthen-9-one |
8-Hydroxy-1,2,3,4,6-pentamethoxy-9H-xanthen-9-one |
1-hydroxy-3,5,6,7,8-pentamethoxy-xanthone |
9H-Xanthen-9-one, 8-hydroxy-1,2,3,4,6-pentamethoxy- |
SCHEMBL15918375 |
DTXSID50212919 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.15% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.02% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.62% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.31% | 99.15% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.72% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.42% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.34% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.00% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 86.91% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.51% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.37% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.46% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 84.02% | 98.75% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.71% | 90.00% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.67% | 93.65% |
CHEMBL3194 | P02766 | Transthyretin | 80.96% | 90.71% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.67% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Centaurium erythraea |
Centaurium littorale |
Schenkia spicata |
PubChem | 5490842 |
LOTUS | LTS0010704 |
wikiData | Q83088145 |