9-(1,3-benzodioxol-5-yl)-4-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-6,7-dimethoxy-1H-benzo[f][2]benzofuran-3-one
Internal ID | d01b30bd-3dba-42be-b15d-57d5a0635241 |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | 9-(1,3-benzodioxol-5-yl)-4-[3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxy-6,7-dimethoxy-1H-benzo[f][2]benzofuran-3-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C(=C3COC(=O)C3=C2OC4C(C(CO4)(CO)O)O)C5=CC6=C(C=C5)OCO6)OC |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)C(=C3COC(=O)C3=C2OC4C(C(CO4)(CO)O)O)C5=CC6=C(C=C5)OCO6)OC |
InChI | InChI=1S/C26H24O11/c1-31-17-6-13-14(7-18(17)32-2)22(37-25-23(28)26(30,9-27)10-34-25)21-15(8-33-24(21)29)20(13)12-3-4-16-19(5-12)36-11-35-16/h3-7,23,25,27-28,30H,8-11H2,1-2H3 |
InChI Key | BJATWCDTYAVIDS-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H24O11 |
Molecular Weight | 512.50 g/mol |
Exact Mass | 512.13186158 g/mol |
Topological Polar Surface Area (TPSA) | 142.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.23% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.59% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 96.74% | 96.77% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.69% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 96.17% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.14% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.11% | 86.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 95.08% | 92.62% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 94.48% | 94.80% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.07% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.31% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.40% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.50% | 100.00% |
CHEMBL2535 | P11166 | Glucose transporter | 86.72% | 98.75% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 86.43% | 95.53% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.26% | 97.14% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.22% | 85.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.10% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.34% | 95.89% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 83.23% | 92.38% |
CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.92% | 97.50% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 80.95% | 97.28% |
CHEMBL1907 | P15144 | Aminopeptidase N | 80.78% | 93.31% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.70% | 96.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 80.32% | 92.98% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Haplophyllum cappadocicum |
Haplophyllum patavinum |
Haplophyllum tuberculatum |
Haplophyllum vulcanicum |
Justicia patentiflora |
PubChem | 162821327 |
LOTUS | LTS0249899 |
wikiData | Q104169308 |