[4,5-Dihydroxy-2-[[2-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | 60944328-193c-4aa4-a0e8-fadc49bcc599 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [4,5-dihydroxy-2-[[2-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-3-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)OC(=O)C=CC6=CC(=C(C=C6)O)OC)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)OC(=O)C=CC6=CC(=C(C=C6)O)OC)O)O |
InChI | InChI=1S/C31H40O17/c1-12-20(36)23(39)26(45-18(35)6-4-13-3-5-15(34)16(9-13)41-2)30(43-12)46-25-14-7-8-42-28(19(14)31(11-33)27(25)48-31)47-29-24(40)22(38)21(37)17(10-32)44-29/h3-9,12,14,17,19-30,32-34,36-40H,10-11H2,1-2H3 |
InChI Key | OKDURJFCTBLRIG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H40O17 |
Molecular Weight | 684.60 g/mol |
Exact Mass | 684.22654980 g/mol |
Topological Polar Surface Area (TPSA) | 256.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.84% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.44% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.08% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.43% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.29% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.93% | 96.09% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.80% | 91.49% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.51% | 97.36% |
CHEMBL3194 | P02766 | Transthyretin | 90.93% | 90.71% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.54% | 92.94% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.27% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.70% | 99.17% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 87.53% | 80.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.78% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.21% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.34% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.63% | 86.92% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 82.51% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Premna microphylla |
Verbascum thapsus |
PubChem | 163004355 |
LOTUS | LTS0051995 |
wikiData | Q105193493 |