(E)-3-[6-O-(3,5-Dimethoxy-4-hydroxybenzoyl)-beta-D-glucopyranosyloxy]stilbene-4',5-diol
Internal ID | da8b57aa-aa1f-413e-93a9-c3596481a99b |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes > Stilbene glycosides |
IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]oxan-2-yl]methyl 4-hydroxy-3,5-dimethoxybenzoate |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C(=O)OCC2C(C(C(C(O2)OC3=CC(=CC(=C3)O)C=CC4=CC=C(C=C4)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=CC(=C3)O)/C=C/C4=CC=C(C=C4)O)O)O)O |
InChI | InChI=1S/C29H30O12/c1-37-21-11-17(12-22(38-2)24(21)32)28(36)39-14-23-25(33)26(34)27(35)29(41-23)40-20-10-16(9-19(31)13-20)4-3-15-5-7-18(30)8-6-15/h3-13,23,25-27,29-35H,14H2,1-2H3/b4-3+/t23-,25-,26+,27-,29-/m1/s1 |
InChI Key | SARSZJDBDZHKQN-IOAVGLNOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H30O12 |
Molecular Weight | 570.50 g/mol |
Exact Mass | 570.17372639 g/mol |
Topological Polar Surface Area (TPSA) | 185.00 Ų |
XlogP | 2.60 |
There are no found synonyms. |
![2D Structure of (E)-3-[6-O-(3,5-Dimethoxy-4-hydroxybenzoyl)-beta-D-glucopyranosyloxy]stilbene-4',5-diol 2D Structure of (E)-3-[6-O-(3,5-Dimethoxy-4-hydroxybenzoyl)-beta-D-glucopyranosyloxy]stilbene-4',5-diol](https://plantaedb.com/storage/docs/compounds/2023/07/e-3-6-o-35-dimethoxy-4-hydroxybenzoyl-beta-d-glucopyranosyloxystilbene-45-diol.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.07% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.23% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.59% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.13% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 94.96% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.03% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.88% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.79% | 89.00% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 91.07% | 85.31% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.22% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.10% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.26% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.14% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.09% | 98.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.65% | 89.62% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.23% | 92.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.66% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aconitum heterophylloides |
Astragalus cibarius |
Fagopyrum megacarpum |
Hylotelephium telephium |
Lysidice brevicalyx |
Vasconcellea cauliflora |
Veratrum dahuricum |
PubChem | 11555996 |
NPASS | NPC117130 |
LOTUS | LTS0138153 |
wikiData | Q105249074 |