Dihydrotanshinone I
Internal ID | f27082a1-6671-437e-afcf-76ac6b64da55 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Tanshinones, isotanshinones, and derivatives |
IUPAC Name | (1R)-1,6-dimethyl-1,2-dihydronaphtho[1,2-g][1]benzofuran-10,11-dione |
SMILES (Canonical) | CC1COC2=C1C(=O)C(=O)C3=C2C=CC4=C(C=CC=C43)C |
SMILES (Isomeric) | C[C@H]1COC2=C1C(=O)C(=O)C3=C2C=CC4=C(C=CC=C43)C |
InChI | InChI=1S/C18H14O3/c1-9-4-3-5-12-11(9)6-7-13-15(12)17(20)16(19)14-10(2)8-21-18(13)14/h3-7,10H,8H2,1-2H3/t10-/m0/s1 |
InChI Key | HARGZZNYNSYSGJ-JTQLQIEISA-N |
Popularity | 153 references in papers |
Molecular Formula | C18H14O3 |
Molecular Weight | 278.30 g/mol |
Exact Mass | 278.094294304 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 3.20 |
Atomic LogP (AlogP) | 3.29 |
H-Bond Acceptor | 3 |
H-Bond Donor | 0 |
Rotatable Bonds | 0 |
87205-99-0 |
15,16-dihydrotanshinone I |
DihydrotanshinoneI |
(-)-Dihydrotanshinone I |
Dihydrotanshinone-I |
Tanshinone I, dihydro- |
HSDB 8105 |
UNII-562G9360V6 |
562G9360V6 |
DTXSID20236187 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 1.0000 | 100.00% |
Caco-2 | + | 0.9002 | 90.02% |
Blood Brain Barrier | + | 0.5678 | 56.78% |
Human oral bioavailability | + | 0.6714 | 67.14% |
Subcellular localzation | Mitochondria | 0.7877 | 78.77% |
OATP2B1 inhibitior | - | 0.8593 | 85.93% |
OATP1B1 inhibitior | + | 0.9413 | 94.13% |
OATP1B3 inhibitior | + | 0.9712 | 97.12% |
MATE1 inhibitior | - | 0.8600 | 86.00% |
OCT2 inhibitior | - | 0.9000 | 90.00% |
BSEP inhibitior | + | 0.6963 | 69.63% |
P-glycoprotein inhibitior | - | 0.6313 | 63.13% |
P-glycoprotein substrate | + | 0.5000 | 50.00% |
CYP3A4 substrate | + | 0.5955 | 59.55% |
CYP2C9 substrate | - | 0.8134 | 81.34% |
CYP2D6 substrate | - | 0.8183 | 81.83% |
CYP3A4 inhibition | - | 0.8310 | 83.10% |
CYP2C9 inhibition | + | 0.8163 | 81.63% |
CYP2C19 inhibition | + | 0.7145 | 71.45% |
CYP2D6 inhibition | - | 0.7503 | 75.03% |
CYP1A2 inhibition | + | 0.9385 | 93.85% |
CYP2C8 inhibition | - | 0.8299 | 82.99% |
CYP inhibitory promiscuity | + | 0.8855 | 88.55% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9543 | 95.43% |
Carcinogenicity (trinary) | Non-required | 0.5280 | 52.80% |
Eye corrosion | - | 0.9764 | 97.64% |
Eye irritation | - | 0.8367 | 83.67% |
Skin irritation | - | 0.7065 | 70.65% |
Skin corrosion | - | 0.9539 | 95.39% |
Ames mutagenesis | + | 0.5900 | 59.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5075 | 50.75% |
Micronuclear | + | 0.6600 | 66.00% |
Hepatotoxicity | + | 0.5524 | 55.24% |
skin sensitisation | + | 0.4773 | 47.73% |
Respiratory toxicity | + | 0.5222 | 52.22% |
Reproductive toxicity | + | 0.6444 | 64.44% |
Mitochondrial toxicity | + | 0.5375 | 53.75% |
Nephrotoxicity | - | 0.7592 | 75.92% |
Acute Oral Toxicity (c) | III | 0.4254 | 42.54% |
Estrogen receptor binding | + | 0.8206 | 82.06% |
Androgen receptor binding | + | 0.7474 | 74.74% |
Thyroid receptor binding | - | 0.6119 | 61.19% |
Glucocorticoid receptor binding | + | 0.6995 | 69.95% |
Aromatase binding | + | 0.5324 | 53.24% |
PPAR gamma | - | 0.4882 | 48.82% |
Honey bee toxicity | - | 0.9242 | 92.42% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5100 | 51.00% |
Fish aquatic toxicity | + | 0.9956 | 99.56% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase |
1000 nM |
IC50 |
PMID: 24900610
|
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase |
398 nM 398 nM |
Ki Ki |
via Super-PRED
PMID: 23286284 |
CHEMBL3180 | O00748 | Carboxylesterase 2 |
118 nM 118 nM 1830 nM |
Ki Ki Ki |
via Super-PRED
PMID: 23286284 PMID: 23286284 |
CHEMBL1250379 | Q15717 | ELAV-like protein 1 |
50 nM |
Ki |
via Super-PRED
|
CHEMBL3166 | P29350 | Protein-tyrosine phosphatase 1C |
3670 nM |
IC50 |
PMID: 23957426
|
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C |
3940 nM |
IC50 |
PMID: 23957426
|
CHEMBL1075138 | Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 |
10000 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.50% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 97.49% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.10% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.11% | 91.49% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.86% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.73% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.19% | 94.73% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.79% | 94.80% |
CHEMBL1907 | P15144 | Aminopeptidase N | 86.65% | 93.31% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 84.61% | 92.98% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.26% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.14% | 86.33% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.86% | 96.00% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.30% | 93.65% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.78% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.85% | 96.00% |
CHEMBL4805 | Q99572 | P2X purinoceptor 7 | 80.58% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 11425923 |
NPASS | NPC988 |
ChEMBL | CHEMBL227075 |
LOTUS | LTS0074988 |
wikiData | Q21099654 |