Derride
Internal ID | 06269c2d-685d-4749-bdc3-975a82ed5e0d |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Rotenoids > Rotenones |
IUPAC Name | 16,17-dimethoxy-2,7,20-trioxapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14,16,18-heptaen-12-one |
SMILES (Canonical) | COC1=C(C=C2C(=C1)C3C(CO2)OC4=C(C3=O)C=CC5=C4C=CO5)OC |
SMILES (Isomeric) | COC1=C(C=C2C(=C1)C3C(CO2)OC4=C(C3=O)C=CC5=C4C=CO5)OC |
InChI | InChI=1S/C20H16O6/c1-22-15-7-12-14(8-16(15)23-2)25-9-17-18(12)19(21)11-3-4-13-10(5-6-24-13)20(11)26-17/h3-8,17-18H,9H2,1-2H3 |
InChI Key | KPSZGBRARBOMHQ-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C20H16O6 |
Molecular Weight | 352.30 g/mol |
Exact Mass | 352.09468823 g/mol |
Topological Polar Surface Area (TPSA) | 67.10 Ų |
XlogP | 3.20 |
SCHEMBL3192891 |
DTXSID80551146 |
LMPK12060009 |
13133-16-9 |
8,9-Dimethoxy-12,12a-dihydrofuro[2',3':7,8][1]benzopyrano[2,3-c][1]benzopyran-6(6aH)-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.21% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.43% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.59% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.18% | 89.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.46% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 89.67% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.67% | 96.09% |
CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 89.23% | 82.67% |
CHEMBL2535 | P11166 | Glucose transporter | 88.61% | 98.75% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.06% | 91.49% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.12% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.93% | 92.94% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 85.51% | 92.38% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.01% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.56% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.44% | 86.33% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 83.97% | 94.03% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.45% | 94.80% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.96% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.77% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.64% | 97.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.39% | 99.17% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 80.29% | 95.78% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.02% | 96.00% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.00% | 91.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Derris elliptica |
Derris trifoliata |
Lonchocarpus salvadorensis |
Millettia duchesnei |
Tephrosia strigosa |
PubChem | 13846199 |
LOTUS | LTS0084142 |
wikiData | Q82430669 |