(1S,2S,4S,6S,7S,8R,9S,12S,13R,15R,16R,18R,19R)-6-methoxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-15-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-16,18,19-triol
| Internal ID | a8e7e827-796c-41ab-bc85-af672a0de96c |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
| IUPAC Name | (1S,2S,4S,6S,7S,8R,9S,12S,13R,15R,16R,18R,19R)-6-methoxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-15-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-16,18,19-triol |
| SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC(C5(C4(CC(C(C5)O)OC6C(C(C(C(O6)CO)O)O)O)C)O)O)C)OC1(CCC(C)COC7C(C(C(C(O7)CO)O)O)O)OC |
| SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3C[C@H]([C@@]5([C@@]4(C[C@H]([C@@H](C5)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)O)O)C)O[C@]1(CC[C@@H](C)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)OC |
| InChI | InChI=1S/C40H68O17/c1-17(16-53-35-33(49)31(47)29(45)25(14-41)55-35)6-9-40(52-5)18(2)28-23(57-40)11-21-19-10-27(44)39(51)12-22(43)24(13-38(39,4)20(19)7-8-37(21,28)3)54-36-34(50)32(48)30(46)26(15-42)56-36/h17-36,41-51H,6-16H2,1-5H3/t17-,18+,19-,20+,21+,22-,23+,24-,25-,26-,27-,28+,29-,30-,31+,32+,33-,34-,35-,36-,37+,38-,39+,40+/m1/s1 |
| InChI Key | IHHVXRVETZYBSD-ILNQFHKZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H68O17 |
| Molecular Weight | 821.00 g/mol |
| Exact Mass | 820.44565070 g/mol |
| Topological Polar Surface Area (TPSA) | 278.00 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
![2D Structure of (1S,2S,4S,6S,7S,8R,9S,12S,13R,15R,16R,18R,19R)-6-methoxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-15-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-16,18,19-triol](https://plantaedb.com/storage/docs/compounds/2023/11/d7993360-864a-11ee-ab32-0b32fb13d27e.jpg "2D Structure of (1S,2S,4S,6S,7S,8R,9S,12S,13R,15R,16R,18R,19R)-6-methoxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-15-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-16,18,19-triol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.71% | 96.09% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 96.51% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.78% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.88% | 85.14% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 94.77% | 95.93% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.74% | 92.86% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 94.57% | 96.21% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.40% | 97.09% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 94.39% | 92.98% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.58% | 97.25% |
| CHEMBL204 | P00734 | Thrombin | 92.39% | 96.01% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 91.84% | 92.38% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 91.58% | 89.05% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.33% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.03% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 88.63% | 98.10% |
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 88.31% | 97.34% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.07% | 95.89% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 87.04% | 98.05% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.32% | 97.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.20% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 86.10% | 96.43% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.34% | 90.17% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.65% | 97.33% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 84.63% | 95.36% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.36% | 82.38% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.36% | 95.50% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 84.32% | 100.00% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.20% | 97.86% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.16% | 97.14% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.56% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.28% | 96.47% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.08% | 100.00% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 82.96% | 99.17% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.87% | 93.18% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 82.69% | 99.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.33% | 95.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.18% | 93.56% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.60% | 94.08% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 81.29% | 97.64% |
| CHEMBL2360 | P00492 | Hypoxanthine-guanine phosphoribosyltransferase | 80.89% | 87.38% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.86% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Allium karataviense |
| Cornus capitata |
| Staphylea japonica |
| PubChem | 162994988 |
| LOTUS | LTS0054563 |
| wikiData | Q104947833 |