[3,4,5,11,21,22,23-Heptahydroxy-8,18-dioxo-13-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-12-yl] 3,4,5-trihydroxybenzoate
Internal ID | 2d412c2f-99a3-4029-a754-e3c0941428b1 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [3,4,5,11,21,22,23-heptahydroxy-8,18-dioxo-13-(3,4,5-trihydroxybenzoyl)oxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-12-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O1)O)O)O)O)O)O |
SMILES (Isomeric) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O1)O)O)O)O)O)O |
InChI | InChI=1S/C34H26O22/c35-12-1-8(2-13(36)21(12)41)30(48)55-29-27(47)28-18(53-34(29)56-31(49)9-3-14(37)22(42)15(38)4-9)7-52-32(50)10-5-16(39)23(43)25(45)19(10)20-11(33(51)54-28)6-17(40)24(44)26(20)46/h1-6,18,27-29,34-47H,7H2 |
InChI Key | OEAQELZCLQUGBM-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C34H26O22 |
Molecular Weight | 786.60 g/mol |
Exact Mass | 786.09157245 g/mol |
Topological Polar Surface Area (TPSA) | 377.00 Ų |
XlogP | 1.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.71% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 97.70% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.26% | 89.00% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 92.12% | 83.00% |
CHEMBL2581 | P07339 | Cathepsin D | 89.87% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.82% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.73% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.33% | 86.33% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.52% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.23% | 95.89% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 86.42% | 95.64% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.75% | 99.23% |
CHEMBL3194 | P02766 | Transthyretin | 85.01% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.47% | 94.73% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.42% | 97.21% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.83% | 99.17% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.42% | 96.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.03% | 92.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.26% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.55% | 96.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.81% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Camellia oleifera |
Juglans regia |
Punica granatum |
PubChem | 146253567 |
LOTUS | LTS0257254 |
wikiData | Q105190148 |