Cyclomorusin
Internal ID | baa8d861-ab9d-4181-bf6e-97e583728d43 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
IUPAC Name | 11,19-dihydroxy-7,7-dimethyl-15-(2-methylprop-1-enyl)-2,8,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,10,17(22),18,20-octaen-13-one |
SMILES (Canonical) | CC(=CC1C2=C(C3=C(O1)C=C(C=C3)O)OC4=C(C2=O)C(=CC5=C4C=CC(O5)(C)C)O)C |
SMILES (Isomeric) | CC(=CC1C2=C(C3=C(O1)C=C(C=C3)O)OC4=C(C2=O)C(=CC5=C4C=CC(O5)(C)C)O)C |
InChI | InChI=1S/C25H22O6/c1-12(2)9-19-21-22(28)20-16(27)11-18-15(7-8-25(3,4)31-18)23(20)30-24(21)14-6-5-13(26)10-17(14)29-19/h5-11,19,26-27H,1-4H3 |
InChI Key | GDQXJMLXEYSICD-UHFFFAOYSA-N |
Popularity | 21 references in papers |
Molecular Formula | C25H22O6 |
Molecular Weight | 418.40 g/mol |
Exact Mass | 418.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 5.20 |
Atomic LogP (AlogP) | 5.46 |
H-Bond Acceptor | 6 |
H-Bond Donor | 2 |
Rotatable Bonds | 1 |
62596-34-3 |
Cyclomorusin A |
Cyclomulberrochromene |
CHEMBL1770313 |
11,19-dihydroxy-7,7-dimethyl-15-(2-methylprop-1-enyl)-2,8,16-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,10,17(22),18,20-octaen-13-one |
Cycolmorusin, 2 |
6,11-Dihydroxy-3,3-dimethyl-8-(2-methyl-propenyl)-3H,8H-bis(1)benzopyrano(4,3-b:6',5'-e)pyran-7-one |
6,11-Dihydroxy-3,3-dimethyl-8-(2-methyl-propenyl)-3H,8H-bis[1]benzopyrano[4,3-b:6',5'-e]pyran-7-one |
DTXSID30978167 |
CHEBI:132868 |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9912 | 99.12% |
Caco-2 | - | 0.5293 | 52.93% |
Blood Brain Barrier | - | 0.6000 | 60.00% |
Human oral bioavailability | - | 0.6000 | 60.00% |
Subcellular localzation | Mitochondria | 0.8195 | 81.95% |
OATP2B1 inhibitior | - | 0.7129 | 71.29% |
OATP1B1 inhibitior | + | 0.8459 | 84.59% |
OATP1B3 inhibitior | + | 0.9725 | 97.25% |
MATE1 inhibitior | - | 0.8000 | 80.00% |
OCT2 inhibitior | - | 1.0000 | 100.00% |
BSEP inhibitior | + | 0.8383 | 83.83% |
P-glycoprotein inhibitior | + | 0.7787 | 77.87% |
P-glycoprotein substrate | + | 0.6258 | 62.58% |
CYP3A4 substrate | + | 0.6638 | 66.38% |
CYP2C9 substrate | - | 0.6192 | 61.92% |
CYP2D6 substrate | - | 0.8382 | 83.82% |
CYP3A4 inhibition | - | 0.6074 | 60.74% |
CYP2C9 inhibition | + | 0.7876 | 78.76% |
CYP2C19 inhibition | + | 0.7874 | 78.74% |
CYP2D6 inhibition | - | 0.7827 | 78.27% |
CYP1A2 inhibition | + | 0.5852 | 58.52% |
CYP2C8 inhibition | + | 0.5163 | 51.63% |
CYP inhibitory promiscuity | + | 0.7852 | 78.52% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.9613 | 96.13% |
Carcinogenicity (trinary) | Non-required | 0.5418 | 54.18% |
Eye corrosion | - | 0.9900 | 99.00% |
Eye irritation | + | 0.5587 | 55.87% |
Skin irritation | - | 0.6965 | 69.65% |
Skin corrosion | - | 0.9655 | 96.55% |
Ames mutagenesis | + | 0.6063 | 60.63% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5787 | 57.87% |
Micronuclear | + | 0.6400 | 64.00% |
Hepatotoxicity | - | 0.6073 | 60.73% |
skin sensitisation | - | 0.6656 | 66.56% |
Respiratory toxicity | + | 0.6111 | 61.11% |
Reproductive toxicity | + | 0.6889 | 68.89% |
Mitochondrial toxicity | + | 0.5625 | 56.25% |
Nephrotoxicity | + | 0.5579 | 55.79% |
Acute Oral Toxicity (c) | III | 0.7408 | 74.08% |
Estrogen receptor binding | + | 0.8648 | 86.48% |
Androgen receptor binding | + | 0.8055 | 80.55% |
Thyroid receptor binding | + | 0.7544 | 75.44% |
Glucocorticoid receptor binding | + | 0.9003 | 90.03% |
Aromatase binding | + | 0.6731 | 67.31% |
PPAR gamma | + | 0.7950 | 79.50% |
Honey bee toxicity | - | 0.6364 | 63.64% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5200 | 52.00% |
Fish aquatic toxicity | + | 0.9767 | 97.67% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL220 | P22303 | Acetylcholinesterase |
3100 nM |
Ki |
DOI: 10.1007/s00044-012-0353-y
|
CHEMBL1914 | P06276 | Butyrylcholinesterase |
1700 nM |
IC50 |
DOI: 10.1007/s00044-012-0353-y
|
CHEMBL4409 | Q9Y233 | Phosphodiesterase 10A |
510 nM |
IC50 |
via Super-PRED
|
CHEMBL2652 | O00408 | Phosphodiesterase 2A |
590 nM |
IC50 |
via Super-PRED
|
CHEMBL288 | Q08499 | Phosphodiesterase 4D |
250 nM 5.4 nM |
IC50 IC50 |
via Super-PRED
via Super-PRED |
CHEMBL1827 | O76074 | Phosphodiesterase 5A |
410 nM |
IC50 |
via Super-PRED
|
CHEMBL3535 | O76083 | Phosphodiesterase 9A |
350 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.43% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.92% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.74% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.36% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.09% | 94.45% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.70% | 93.10% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.30% | 90.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.91% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.41% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.19% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.29% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.07% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 81.79% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.77% | 94.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.02% | 100.00% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 80.87% | 91.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.28% | 96.09% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 80.14% | 98.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
Artocarpus elasticus |
Artocarpus heterophyllus |
Morus alba |
Morus indica |
Sorocea bonplandii |
PubChem | 5481969 |
NPASS | NPC189087 |
ChEMBL | CHEMBL1770313 |
LOTUS | LTS0010612 |
wikiData | Q72460180 |