Cryptolepine
| Internal ID | 32040020-57d7-4272-b414-75b0824d7096 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Indoloquinolines |
| IUPAC Name | 5-methylindolo[3,2-b]quinoline |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H12N2/c1-18-15-9-5-2-6-11(15)10-14-16(18)12-7-3-4-8-13(12)17-14/h2-10H,1H3 |
| InChI Key | KURWKDDWCJELSV-UHFFFAOYSA-N |
| Popularity | 308 references in papers |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.100048391 g/mol |
| Topological Polar Surface Area (TPSA) | 17.80 Ų |
| XlogP | 3.30 |
| 480-26-2 |
| CCRIS 9019 |
| 5-methylindolo[3,2-b]quinoline |
| 5H-Quindoline, 5-methyl- |
| CHEBI:3930 |
| OF1UIT4RDH |
| DTXSID6037645 |
| 5-methylindolo(3,2-b)quinoline |
| RefChem:128608 |
| DTXCID4017645 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL2916 | O14746 | Telomerase reverse transcriptase |
9400 nM 9400 nM |
IC50 IC50 |
PMID: 23974014
DOI: 10.1039/C0MD00241K |
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.82% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.11% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.09% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.72% | 98.95% |
| CHEMBL240 | Q12809 | HERG | 92.27% | 89.76% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.28% | 94.62% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 87.76% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.22% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.41% | 85.14% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 84.24% | 96.25% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.90% | 93.99% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.81% | 94.73% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 82.54% | 95.00% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 80.76% | 92.67% |
| CHEMBL1936 | P10721 | Stem cell growth factor receptor | 80.28% | 84.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.09% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cryptolepis sanguinolenta |
| Micropholis guyanensis |
| Sida acuta |
| Wisteria brachybotrys |
| PubChem | 82143 |
| NPASS | NPC296163 |
| ChEMBL | CHEMBL119096 |
| LOTUS | LTS0148657 |
| wikiData | Q5190964 |