Cryptoflavin
Internal ID | 8e01e59e-dcbc-49f6-a486-b8d30815a4d7 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Tetraterpenoids > Carotenoids > Xanthophylls |
IUPAC Name | 4-[(1E,3E,5E,7E,9E,11E,13E,15E)-16-(4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl)-3,7,12-trimethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
SMILES (Canonical) | CC1=C(C(CC(C1)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C2C=C3C(CCCC3(O2)C)(C)C)C)C |
SMILES (Isomeric) | CC1=C(C(CC(C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C2C=C3C(CCCC3(O2)C)(C)C)/C)/C |
InChI | InChI=1S/C40H56O2/c1-29(18-13-19-31(3)22-23-35-33(5)26-34(41)28-39(35,8)9)16-11-12-17-30(2)20-14-21-32(4)36-27-37-38(6,7)24-15-25-40(37,10)42-36/h11-14,16-23,27,34,36,41H,15,24-26,28H2,1-10H3/b12-11+,18-13+,20-14+,23-22+,29-16+,30-17+,31-19+,32-21+ |
InChI Key | WEJIOGMJJWSQFC-NNAJIMERSA-N |
Popularity | 4 references in papers |
Molecular Formula | C40H56O2 |
Molecular Weight | 568.90 g/mol |
Exact Mass | 568.42803102 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 11.10 |
Cryptoxanthin 5,8-epoxide |
SCHEMBL2837893 |
CHEBI:176090 |
WEJIOGMJJWSQFC-NNAJIMERSA-N |
DTXSID701317895 |
30311-63-8 |
5,8-Epoxy-5,8-dihydro-b,b-caroten-3-ol |
4-[(1E,3E,5E,7E,9E,11E,13E,15E)-16-(4,4,7a-Trimethyl-2,4,5,6,7,7a-hexahydro-1-benzofuran-2-yl)-3,7,12-trimethyl-1,3,5,7,9,11,13,15-heptadecaoctaenyl]-3,5,5-trimethyl-3-cyclohexen-1-ol # |
4-[(1E,3E,5E,7E,9E,11E,13E,15E)-16-(4,4,7a-trimethyl-2,4,5,6,7,7a-hexahydro-1-benzofuran-2-yl)-3,7,12-trimethylheptadeca-1,3,5,7,9,11,13,15-octaen-1-yl]-3,5,5-trimethylcyclohex-3-en-1-ol |
4-[(1E,3E,5E,7E,9E,11E,13E,15E)-16-(4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzouran-2-yl)-3,7,12-trimethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.89% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.75% | 96.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.85% | 93.99% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.94% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.63% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.43% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.15% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 85.77% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.67% | 95.89% |
CHEMBL2061 | P19793 | Retinoid X receptor alpha | 85.39% | 91.67% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.32% | 100.00% |
CHEMBL2004 | P48443 | Retinoid X receptor gamma | 85.20% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.69% | 92.94% |
CHEMBL1870 | P28702 | Retinoid X receptor beta | 83.63% | 95.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.95% | 91.71% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.99% | 94.75% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.86% | 93.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.50% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.37% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Citrus cavaleriei |
Diospyros kaki |
Pteridium aquilinum |
PubChem | 5376350 |
LOTUS | LTS0070797 |
wikiData | Q104252273 |