Coumarin 7
Internal ID | 25762400-eabd-460e-b1d6-8063226121d3 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | 3-(1H-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one |
SMILES (Canonical) | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C3=NC4=CC=CC=C4N3 |
SMILES (Isomeric) | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C3=NC4=CC=CC=C4N3 |
InChI | InChI=1S/C20H19N3O2/c1-3-23(4-2)14-10-9-13-11-15(20(24)25-18(13)12-14)19-21-16-7-5-6-8-17(16)22-19/h5-12H,3-4H2,1-2H3,(H,21,22) |
InChI Key | GOLORTLGFDVFDW-UHFFFAOYSA-N |
Popularity | 45 references in papers |
Molecular Formula | C20H19N3O2 |
Molecular Weight | 333.40 g/mol |
Exact Mass | 333.147726857 g/mol |
Topological Polar Surface Area (TPSA) | 58.20 Ų |
XlogP | 4.00 |
Atomic LogP (AlogP) | 4.18 |
H-Bond Acceptor | 4 |
H-Bond Donor | 1 |
Rotatable Bonds | 4 |
27425-55-4 |
3-(2-Benzimidazolyl)-7-(diethylamino)coumarin |
DISPERSE YELLOW 82 |
12239-58-6 |
2H-1-Benzopyran-2-one, 3-(1H-benzimidazol-2-yl)-7-(diethylamino)- |
Coumarin, 3-(2-benzimidazolyl)-7-(diethylamino)- |
3-(1H-benzo[d]imidazol-2-yl)-7-(diethylamino)-2H-chromen-2-one |
3-(1H-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one |
3-(1H-Benzimidazol-2-yl)-7-(diethylamino)-2-benzopyrone |
3-(1H-Benzimidazol-2-yl)-7-(diethylamino)-2H-chromen-2-one |
There are more than 10 synonyms. If you wish to see them all click here. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9954 | 99.54% |
Caco-2 | + | 0.5797 | 57.97% |
Blood Brain Barrier | + | 0.7000 | 70.00% |
Human oral bioavailability | + | 0.5857 | 58.57% |
Subcellular localzation | Lysosomes | 0.5726 | 57.26% |
OATP2B1 inhibitior | - | 0.7145 | 71.45% |
OATP1B1 inhibitior | + | 0.9133 | 91.33% |
OATP1B3 inhibitior | + | 0.9398 | 93.98% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.8750 | 87.50% |
BSEP inhibitior | + | 0.9412 | 94.12% |
P-glycoprotein inhibitior | + | 0.6903 | 69.03% |
P-glycoprotein substrate | - | 0.5851 | 58.51% |
CYP3A4 substrate | + | 0.5297 | 52.97% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8316 | 83.16% |
CYP3A4 inhibition | - | 0.6006 | 60.06% |
CYP2C9 inhibition | - | 0.6802 | 68.02% |
CYP2C19 inhibition | + | 0.6285 | 62.85% |
CYP2D6 inhibition | - | 0.6521 | 65.21% |
CYP1A2 inhibition | + | 0.8030 | 80.30% |
CYP2C8 inhibition | + | 0.6771 | 67.71% |
CYP inhibitory promiscuity | + | 0.7727 | 77.27% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8900 | 89.00% |
Carcinogenicity (trinary) | Non-required | 0.4482 | 44.82% |
Eye corrosion | - | 0.9902 | 99.02% |
Eye irritation | - | 0.6937 | 69.37% |
Skin irritation | - | 0.7876 | 78.76% |
Skin corrosion | - | 0.9508 | 95.08% |
Ames mutagenesis | - | 0.5724 | 57.24% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.8729 | 87.29% |
Micronuclear | + | 0.8900 | 89.00% |
Hepatotoxicity | + | 0.6000 | 60.00% |
skin sensitisation | - | 0.8646 | 86.46% |
Respiratory toxicity | + | 0.6889 | 68.89% |
Reproductive toxicity | + | 0.6889 | 68.89% |
Mitochondrial toxicity | + | 0.9375 | 93.75% |
Nephrotoxicity | - | 0.6335 | 63.35% |
Acute Oral Toxicity (c) | III | 0.5116 | 51.16% |
Estrogen receptor binding | + | 0.8702 | 87.02% |
Androgen receptor binding | + | 0.7458 | 74.58% |
Thyroid receptor binding | + | 0.7348 | 73.48% |
Glucocorticoid receptor binding | + | 0.8422 | 84.22% |
Aromatase binding | + | 0.8603 | 86.03% |
PPAR gamma | + | 0.9090 | 90.90% |
Honey bee toxicity | - | 0.9018 | 90.18% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5600 | 56.00% |
Fish aquatic toxicity | + | 0.8317 | 83.17% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL5990 | P38398 | Breast cancer type 1 susceptibility protein |
125.9 nM 125.9 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL4801 | P29466 | Caspase-1 |
158.5 nM 158.5 nM |
Potency Potency |
via CMAUP
via Super-PRED |
CHEMBL3468 | P55210 | Caspase-7 |
158.5 nM 158.5 nM |
Potency Potency |
via CMAUP
via Super-PRED |
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
316.2 nM 398.1 nM 316.2 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via Super-PRED |
CHEMBL4331 | P68871 | Hemoglobin beta chain |
794.3 nM 794.3 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1293299 | Q03164 | Histone-lysine N-methyltransferase MLL |
446.7 nM 446.7 nM |
Potency Potency |
via CMAUP
via Super-PRED |
CHEMBL5514 | P42858 | Huntingtin |
316.2 nM 316.2 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
1584.9 nM |
Potency |
via CMAUP
|
CHEMBL5162 | Q6W5P4 | Neuropeptide S receptor |
12589.3 nM |
Potency |
via CMAUP
|
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein |
281.8 nM 281.8 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
1122 nM |
Potency |
via CMAUP
|
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta |
2324 nM |
IC50 |
via CMAUP
|
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A |
100 nM 100 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL3797 | Q13315 | Serine-protein kinase ATM |
8912.5 nM |
Potency |
via CMAUP
|
CHEMBL1293227 | O75604 | Ubiquitin carboxyl-terminal hydrolase 2 |
199.5 nM 199.5 nM 891.3 nM |
Potency Potency Potency |
via Super-PRED
via CMAUP via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.19% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 96.63% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.49% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.34% | 93.99% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.28% | 94.00% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 91.11% | 96.67% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 90.57% | 85.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.33% | 89.00% |
CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 89.29% | 95.70% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.03% | 99.23% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 87.93% | 93.65% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.24% | 94.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.28% | 95.56% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 85.78% | 85.49% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.62% | 92.97% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 83.82% | 98.59% |
CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 83.52% | 95.48% |
CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 83.46% | 96.47% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 82.14% | 97.00% |
CHEMBL1628481 | P35414 | Apelin receptor | 81.81% | 97.89% |
CHEMBL2535 | P11166 | Glucose transporter | 81.20% | 98.75% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 80.49% | 92.98% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 94381 |
NPASS | NPC187145 |
ChEMBL | CHEMBL374632 |