Cnidioside B
Internal ID | cfc98fc0-442d-4996-9163-52bcdc04df42 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | 3-[7-methoxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-benzofuran-5-yl]propanoic acid |
SMILES (Canonical) | COC1=C2C(=CC(=C1OC3C(C(C(C(O3)CO)O)O)O)CCC(=O)O)C=CO2 |
SMILES (Isomeric) | COC1=C2C(=CC(=C1O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)CCC(=O)O)C=CO2 |
InChI | InChI=1S/C18H22O10/c1-25-17-15-9(4-5-26-15)6-8(2-3-11(20)21)16(17)28-18-14(24)13(23)12(22)10(7-19)27-18/h4-6,10,12-14,18-19,22-24H,2-3,7H2,1H3,(H,20,21)/t10-,12-,13+,14-,18+/m1/s1 |
InChI Key | YVYNMIFMUKDFEC-AXOAAPQKSA-N |
Popularity | 3 references in papers |
Molecular Formula | C18H22O10 |
Molecular Weight | 398.40 g/mol |
Exact Mass | 398.12129689 g/mol |
Topological Polar Surface Area (TPSA) | 159.00 Ų |
XlogP | -0.10 |
141896-54-0 |
MEGxp0_001375 |
HY-N11540 |
AKOS040735862 |
NCGC00384499-01 |
CS-0649312 |
NCGC00384499-01_C18H22O10_5-Benzofuranpropanoic acid, 6-(beta-D-glucopyranosyloxy)-7-methoxy- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.69% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.73% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.56% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.45% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.49% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.47% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.36% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.52% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.27% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.34% | 94.73% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.00% | 92.62% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.84% | 86.92% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ammi majus |
Leptothyrsa sprucei |
Picrasma quassioides |
Ruta graveolens |
PubChem | 24148534 |
LOTUS | LTS0114915 |
wikiData | Q105366304 |