cis-3,5,3',4'-Tetrahydroxystilbene
Internal ID | b595a83f-15ed-425a-b5d6-3fceb1a858d4 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 4-[(Z)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
SMILES (Canonical) | C1=CC(=C(C=C1C=CC2=CC(=CC(=C2)O)O)O)O |
SMILES (Isomeric) | C1=CC(=C(C=C1/C=C\C2=CC(=CC(=C2)O)O)O)O |
InChI | InChI=1S/C14H12O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h1-8,15-18H/b2-1- |
InChI Key | CDRPUGZCRXZLFL-UPHRSURJSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C14H12O4 |
Molecular Weight | 244.24 g/mol |
Exact Mass | 244.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 80.90 Ų |
XlogP | 2.90 |
Atomic LogP (AlogP) | 2.68 |
H-Bond Acceptor | 4 |
H-Bond Donor | 4 |
Rotatable Bonds | 2 |
106325-86-4 |
cis-3,5,3',4'-tetrahydroxystilbene |
4-[(Z)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
CHEBI:76156 |
Lopac-P-0453 |
CHEMBL1603409 |
SCHEMBL19953785 |
DTXSID40424968 |
CDRPUGZCRXZLFL-UPHRSURJSA-N |
(Z)-3,5,3',4'-tetrahydroxystilbene |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9403 | 94.03% |
Caco-2 | + | 0.7659 | 76.59% |
Blood Brain Barrier | - | 0.7000 | 70.00% |
Human oral bioavailability | - | 0.5857 | 58.57% |
Subcellular localzation | Mitochondria | 0.5195 | 51.95% |
OATP2B1 inhibitior | - | 0.6931 | 69.31% |
OATP1B1 inhibitior | + | 0.9789 | 97.89% |
OATP1B3 inhibitior | + | 0.9799 | 97.99% |
MATE1 inhibitior | - | 0.9000 | 90.00% |
OCT2 inhibitior | - | 0.9088 | 90.88% |
BSEP inhibitior | - | 0.6653 | 66.53% |
P-glycoprotein inhibitior | - | 0.9568 | 95.68% |
P-glycoprotein substrate | - | 0.9936 | 99.36% |
CYP3A4 substrate | - | 0.7238 | 72.38% |
CYP2C9 substrate | - | 0.5963 | 59.63% |
CYP2D6 substrate | - | 0.7204 | 72.04% |
CYP3A4 inhibition | + | 0.5427 | 54.27% |
CYP2C9 inhibition | + | 0.6182 | 61.82% |
CYP2C19 inhibition | - | 0.9026 | 90.26% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | + | 0.9107 | 91.07% |
CYP2C8 inhibition | - | 0.6100 | 61.00% |
CYP inhibitory promiscuity | + | 0.7651 | 76.51% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.7723 | 77.23% |
Carcinogenicity (trinary) | Non-required | 0.5596 | 55.96% |
Eye corrosion | - | 0.9698 | 96.98% |
Eye irritation | + | 0.9970 | 99.70% |
Skin irritation | + | 0.6089 | 60.89% |
Skin corrosion | - | 0.5875 | 58.75% |
Ames mutagenesis | - | 0.6200 | 62.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.7864 | 78.64% |
Micronuclear | + | 0.7400 | 74.00% |
Hepatotoxicity | - | 0.5964 | 59.64% |
skin sensitisation | + | 0.9376 | 93.76% |
Respiratory toxicity | - | 0.6667 | 66.67% |
Reproductive toxicity | + | 0.5222 | 52.22% |
Mitochondrial toxicity | - | 0.7250 | 72.50% |
Nephrotoxicity | - | 0.5896 | 58.96% |
Acute Oral Toxicity (c) | III | 0.7909 | 79.09% |
Estrogen receptor binding | + | 0.9138 | 91.38% |
Androgen receptor binding | + | 0.8411 | 84.11% |
Thyroid receptor binding | + | 0.7823 | 78.23% |
Glucocorticoid receptor binding | + | 0.8424 | 84.24% |
Aromatase binding | + | 0.9377 | 93.77% |
PPAR gamma | + | 0.9167 | 91.67% |
Honey bee toxicity | - | 0.8277 | 82.77% |
Biodegradation | - | 0.8250 | 82.50% |
Crustacea aquatic toxicity | + | 0.5900 | 59.00% |
Fish aquatic toxicity | + | 0.9851 | 98.51% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL3687 | P18054 | Arachidonate 12-lipoxygenase |
15848.9 nM |
Potency |
via CMAUP
|
CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
794.3 nM 794.3 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase |
240 nM |
IC50 |
via Super-PRED
|
CHEMBL4801 | P29466 | Caspase-1 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
10000 nM 12589.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
5011.87 nM |
AC50 |
via CMAUP
|
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
31622.78 nM |
AC50 |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
19952.6 nM 19952.6 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
1995.3 nM 31622.8 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL2424 | Q04760 | Glyoxalase I |
760 nM |
IC50 |
via Super-PRED
|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
10000 nM 10000 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293235 | P02545 | Prelamin-A/C |
56.2 nM |
Potency |
via Super-PRED
|
CHEMBL1075189 | P14618 | Pyruvate kinase isozymes M1/M2 |
2511.9 nM 2511.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293256 | P40225 | Thrombopoietin |
2511.9 nM 2511.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 98.80% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.61% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 96.88% | 90.71% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 93.27% | 96.12% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.51% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.81% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.53% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.72% | 86.33% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 83.75% | 80.78% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.78% | 89.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 81.33% | 91.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.93% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.66% | 94.73% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.40% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rheum australe |
Rhodomyrtus tomentosa |
Smilax china |
PubChem | 6603962 |
NPASS | NPC58427 |
ChEMBL | CHEMBL1603409 |