CID 634946
| Internal ID | 2eb3a5de-5808-4a13-9c28-4ffd3bd248ea |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
| IUPAC Name | 3,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene-8,19-diol |
| SMILES (Canonical) | CC1(C2CCC3(CC4=CCC5C(C(CCC5(C4CCC3C2(CCC1O)C)C)O)(C)C)C)C |
| SMILES (Isomeric) | CC1(C2CCC3(CC4=CCC5C(C(CCC5(C4CCC3C2(CCC1O)C)C)O)(C)C)C)C |
| InChI | InChI=1S/C30H50O2/c1-26(2)21-10-8-19-18-28(5)15-12-22-27(3,4)25(32)14-17-30(22,7)23(28)11-9-20(19)29(21,6)16-13-24(26)31/h8,20-25,31-32H,9-18H2,1-7H3 |
| InChI Key | FMUNNDDBCLRMSL-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.70 g/mol |
| Exact Mass | 442.381080833 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 7.50 |
| 1449-06-5 |
| 3,7,7,11,16,20,20-Heptamethylpentacyclo[13.8.0.03,12.06,11.016,21]tricos-1(23)-ene-8,19-diol |
| FMUNNDDBCLRMSL-UHFFFAOYSA-N |
| BAA44906 |
| AKOS032948102 |
| A884714 |
| B0005-166541 |
| 18,22,22-Trimethyl-17,27,29,30-tetranor-c-homoolean-14-ene-3beta,21alpha-diol |
| (3S,6R,8S,11R,12S,15S,16R,19R,21R)-3,7,7,11,16,20,20-heptamethylpentacyclo[13.8.0.0^{3,12.0^{6,11.0^{16,21]tricos-1(23)-ene-8,19-diol |
| 1H-Cyclohepta[1,2-a:5,4-a']dinaphthalene-3,11-diol,2,3,4,4a,5,6,6a,7,9,9a,10,11,12,13,13a,13b,14,15,15a,15b-eicosahydro-4,4,6a,10,10,13a,15b-heptamethyl-,(3S,4aR,6aS,9aR,11R,13aR,13bS,15aS,15bR)- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.31% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.10% | 90.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.88% | 97.25% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 91.31% | 85.30% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.99% | 95.89% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.28% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.90% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.14% | 91.11% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 83.25% | 85.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.95% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.62% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Huperzia lucidula |
| Huperzia serrata |
| Lycopodiella cernua |
| Lycopodiella inundata |
| Lycopodium clavatum |
| Lycopodium deuterodensum |
| Picea jezoensis |
| Picea sitchensis |
| Pinus armandii |
| Pinus luchuensis |
| PubChem | 634946 |
| LOTUS | LTS0197893 |
| wikiData | Q104398694 |